The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-Hydroxybutyl)-[2-(5-iodothiophen-2-yl)ethyl]-dimethylammonium 4-Methylbenzenesulfonate ID: ALA5278214
Max Phase: Preclinical
Molecular Formula: C19H28INO4S2
Molecular Weight: 354.28
Associated Items:
Names and Identifiers Canonical SMILES: C[N+](C)(CCCCO)CCc1ccc(I)s1.Cc1ccc(S(=O)(=O)[O-])cc1
Standard InChI: InChI=1S/C12H21INOS.C7H8O3S/c1-14(2,8-3-4-10-15)9-7-11-5-6-12(13)16-11;1-6-2-4-7(5-3-6)11(8,9)10/h5-6,15H,3-4,7-10H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1
Standard InChI Key: ADNCCJMRHYGSPB-UHFFFAOYSA-M
Molfile:
RDKit 2D
27 27 0 0 0 0 0 0 0 0999 V2000
0.3639 1.8562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8007 2.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0728 2.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3931 1.4194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1500 1.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9073 1.4194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9946 0.5457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8391 0.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2758 1.1282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6934 1.7688 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.1494 1.2155 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
1.1211 1.4194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8781 1.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6352 1.4194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3923 1.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1494 1.4194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1038 -1.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1038 -2.2008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3888 -2.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6739 -2.2008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6739 -1.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3888 -0.9633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0410 -2.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8187 -0.9633 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.8190 -0.1379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2322 -1.6795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6442 -0.9633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
6 10 1 0
9 11 1 0
1 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
20 23 1 0
17 24 1 0
24 25 1 0
24 26 2 0
24 27 2 0
M CHG 2 1 1 25 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 354.28Molecular Weight (Monoisotopic): 354.0383AlogP: 2.74#Rotatable Bonds: 7Polar Surface Area: 20.23Molecular Species: NEUTRALHBA: 2HBD: 1#RO5 Violations: ┄HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: -1.06CX LogD: -1.06Aromatic Rings: 1Heavy Atoms: 16QED Weighted: 0.45Np Likeness Score: 0.02
References 1. Švec P, Nový Z, Kučka J, Petřík M, Sedláček O, Kuchař M, Lišková B, Medvedíková M, Kolouchová K, Groborz O, Loukotová L, Konefał RŁ, Hajdúch M, Hrubý M.. (2020) Iodinated Choline Transport-Targeted Tracers., 63 (24): [PMID:33271015 ] [10.1021/acs.jmedchem.0c01710 ]