7-((5-(5-chloro-2-(2,4-dichlorophenoxy)phenoxy)pentyl)oxy)-4-methyl-2H-chromen-2-one

ID: ALA5278236

Max Phase: Preclinical

Molecular Formula: C27H23Cl3O5

Molecular Weight: 533.84

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(=O)oc2cc(OCCCCCOc3cc(Cl)ccc3Oc3ccc(Cl)cc3Cl)ccc12

Standard InChI:  InChI=1S/C27H23Cl3O5/c1-17-13-27(31)35-25-16-20(7-8-21(17)25)32-11-3-2-4-12-33-26-15-19(29)6-10-24(26)34-23-9-5-18(28)14-22(23)30/h5-10,13-16H,2-4,11-12H2,1H3

Standard InChI Key:  QFRGSLKUAFBANY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -4.9964    0.0034    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -4.9964   -0.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7108   -1.2337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7108   -2.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9946   -2.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2847   -2.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2847   -1.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5703   -0.8208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8558   -1.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1412   -0.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1412    0.0039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4268    0.4164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7124    0.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0020    0.4164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4293   -1.2328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4293   -2.0581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1395   -2.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8558   -2.0618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149   -2.4705    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -6.4253   -2.4744    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.7164    0.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4309    0.4164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1453    0.0039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8597    0.4164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8600    1.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5727    1.6520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2873    1.2394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9955    1.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9955    2.4744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7075    1.2405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7109    0.4238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0038    0.0079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2889    0.4185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5773    0.0021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4253    0.0113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  7  8  1  0
  8  9  1  0
 10  9  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 15 10  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
  9 18  1  0
 16 19  1  0
  4 20  1  0
 14 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 27 28  1  0
 28 29  1  0
 30 28  2  0
 31 30  1  0
 32 31  1  0
 33 32  1  0
 33 27  1  0
 34 33  2  0
 24 34  1  0
 31 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5278236

    ---

Associated Targets(non-human)

Leishmania panamensis (230 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 533.84Molecular Weight (Monoisotopic): 532.0611AlogP: 8.48#Rotatable Bonds: 10
Polar Surface Area: 57.90Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 7.90CX LogD: 7.90
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.15Np Likeness Score: -0.58

References

1. Gonçalves GA, Spillere AR, das Neves GM, Kagami LP, von Poser GL, Canto RFS, Eifler-Lima V..  (2020)  Natural and synthetic coumarins as antileishmanial agents: A review.,  203  [PMID:32668302] [10.1016/j.ejmech.2020.112514]

Source