The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(N-(3,4,5-trimethoxyphenyl)quinoline-8-sulfonamido)propyl 4-acetylpiperazine-1-carbodithioate ID: ALA5278238
Max Phase: Preclinical
Molecular Formula: C28H34N4O6S3
Molecular Weight: 618.80
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N(CCCSC(=S)N2CCN(C(C)=O)CC2)S(=O)(=O)c2cccc3cccnc23)cc(OC)c1OC
Standard InChI: InChI=1S/C28H34N4O6S3/c1-20(33)30-13-15-31(16-14-30)28(39)40-17-7-12-32(22-18-23(36-2)27(38-4)24(19-22)37-3)41(34,35)25-10-5-8-21-9-6-11-29-26(21)25/h5-6,8-11,18-19H,7,12-17H2,1-4H3
Standard InChI Key: UNWMPMPWRRVZKX-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
-5.3570 1.6469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6425 2.0593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9280 1.6469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9280 0.8185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6425 0.4061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6425 -0.4188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2119 0.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5019 0.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7875 0.4098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7875 -0.4151 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.2696 -1.0639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9625 -0.4151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5021 -0.8276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2195 -0.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9311 -0.8297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9311 -1.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2149 -2.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2149 -2.8892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5014 -3.2966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7932 -2.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7932 -2.0637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5021 -1.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0730 0.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3586 0.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3558 0.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0702 0.4098 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.7847 0.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7847 1.6473 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.4992 0.4098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4992 -0.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2136 -0.8276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9281 -0.4151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6425 -0.8276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3570 -0.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6425 -1.6526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9281 0.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2136 0.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5019 1.6473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2136 2.0591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2136 2.8841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9281 3.2966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
3 4 1 0
4 5 1 0
5 6 1 0
4 7 2 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
10 12 2 0
10 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
22 21 1 0
17 22 1 0
22 13 2 0
9 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
27 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
33 35 2 0
32 36 1 0
36 37 1 0
37 29 1 0
8 38 2 0
38 39 1 0
39 3 2 0
39 40 1 0
40 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 618.80Molecular Weight (Monoisotopic): 618.1640AlogP: 4.03#Rotatable Bonds: 10Polar Surface Area: 101.51Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 0.46CX LogP: 2.91CX LogD: 2.91Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.24Np Likeness Score: -1.23
References 1. Van de Walle T, Cools L, Mangelinckx S, D'hooghe M.. (2021) Recent contributions of quinolines to antimalarial and anticancer drug discovery research., 226 [PMID:34655985 ] [10.1016/j.ejmech.2021.113865 ]