The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(4-((7-chloroquinolin-4-yl)oxy)-3-methoxybenzylidene)hydrazinyl)-4-(4-nitrophenyl)thiazole ID: ALA5278321
Max Phase: Preclinical
Molecular Formula: C26H18ClN5O4S
Molecular Weight: 531.98
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=N/Nc2nc(-c3ccc([N+](=O)[O-])cc3)cs2)ccc1Oc1ccnc2cc(Cl)ccc12
Standard InChI: InChI=1S/C26H18ClN5O4S/c1-35-25-12-16(2-9-24(25)36-23-10-11-28-21-13-18(27)5-8-20(21)23)14-29-31-26-30-22(15-37-26)17-3-6-19(7-4-17)32(33)34/h2-15H,1H3,(H,30,31)/b29-14+
Standard InChI Key: YNTOLCJGAHTALP-IPPBACCNSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
1.7952 2.0733 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.5097 1.6609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5097 0.8425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2230 0.4307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9345 0.8395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9345 1.6620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2195 2.0755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6492 2.0747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3656 1.6656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3656 0.8411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6481 0.4268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6481 -0.3981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9337 -0.8106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9337 -1.6356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6481 -2.0481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3626 -1.6356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2238 -2.0473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5076 -1.6393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7931 -2.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0786 -1.6393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3642 -2.0518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3502 -1.6393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4364 -0.8192 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.2430 -0.6477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6553 -1.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4803 -1.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8945 -0.6443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7191 -0.6443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1281 -1.3608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7155 -2.0755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8930 -2.0755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1034 -1.9747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5076 -0.8110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2220 -0.3988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9531 -1.3608 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.3656 -0.6464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3656 -2.0752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 2 0
5 4 1 0
6 5 1 0
6 7 1 0
7 2 2 0
8 6 2 0
9 8 1 0
10 9 2 0
11 10 1 0
5 11 2 0
12 11 1 0
13 12 1 0
14 13 2 0
14 15 1 0
15 16 1 0
17 14 1 0
18 17 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
23 22 1 0
24 23 1 0
25 24 2 0
26 25 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 26 2 0
32 25 1 0
32 22 2 0
33 18 1 0
34 33 2 0
13 34 1 0
35 29 1 0
35 36 1 0
35 37 2 0
M CHG 2 35 1 36 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 531.98Molecular Weight (Monoisotopic): 531.0768AlogP: 7.17#Rotatable Bonds: 8Polar Surface Area: 111.77Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.75CX Basic pKa: 4.96CX LogP: 7.22CX LogD: 7.21Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.13Np Likeness Score: -1.60