The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(3,5-difluorophenyl)-6-(3-methoxyphenyl)quinolin-4-yl)piperidin-4-amine ID: ALA5278345
Max Phase: Preclinical
Molecular Formula: C27H25F2N3O
Molecular Weight: 445.51
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(-c2ccc3ncc(-c4cc(F)cc(F)c4)c(N4CCC(N)CC4)c3c2)c1
Standard InChI: InChI=1S/C27H25F2N3O/c1-33-23-4-2-3-17(13-23)18-5-6-26-24(14-18)27(32-9-7-22(30)8-10-32)25(16-31-26)19-11-20(28)15-21(29)12-19/h2-6,11-16,22H,7-10,30H2,1H3
Standard InChI Key: PRWZVZWQSRHWCY-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-0.3518 1.2392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3518 0.4142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3625 0.0017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0770 0.4142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0770 1.2392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3626 1.6517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3626 2.4767 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3625 -0.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3520 -1.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3520 -2.0642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3643 -2.4723 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0745 -2.0605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0745 -1.2353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7891 -0.8227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7893 0.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5020 0.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5020 1.2379 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.2167 0.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2183 -0.8206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5066 -1.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9328 -1.2331 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.0676 -2.4767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7855 -2.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7873 -1.2382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0727 -0.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5018 -0.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2165 -1.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9284 -0.8260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9284 -0.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2183 0.4109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5018 0.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2183 1.2360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9328 1.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 1 1 0
6 7 1 0
3 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
14 13 1 0
15 14 2 0
16 15 1 0
16 17 1 0
18 16 2 0
19 18 1 0
20 19 2 0
14 20 1 0
19 21 1 0
10 22 1 0
23 22 2 0
24 23 1 0
25 24 2 0
9 25 1 0
26 24 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
26 31 1 0
31 30 2 0
30 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.51Molecular Weight (Monoisotopic): 445.1966AlogP: 5.78#Rotatable Bonds: 4Polar Surface Area: 51.38Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.03CX LogP: 4.87CX LogD: 2.01Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.43Np Likeness Score: -0.83
References 1. Zhao J, Wang S, Markison S, Kim SH, Han S, Chen M, Kusnetzow AK, Rico-Bautista E, Johns M, Luo R, Struthers RS, Madan A, Zhu Y, Betz SF.. (2023) Discovery of Paltusotine (CRN00808), a Potent, Selective, and Orally Bioavailable Non-peptide SST2 Agonist., 14 (1.0): [PMID:36655128 ] [10.1021/acsmedchemlett.2c00431 ]