1-(2-ethyl-8-fluoro-1,2,3,4-tetrahydro-5H-pyrido[4,3-b]indol-5-yl)-3-(1,2,3,4-tetrahydro-9H-carbazol-9-yl)propan-2-ol hydrochloride

ID: ALA5278371

Max Phase: Preclinical

Molecular Formula: C28H33ClFN3O

Molecular Weight: 445.58

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN1CCc2c(c3cc(F)ccc3n2CC(O)Cn2c3c(c4ccccc42)CCCC3)C1.Cl

Standard InChI:  InChI=1S/C28H32FN3O.ClH/c1-2-30-14-13-28-24(18-30)23-15-19(29)11-12-27(23)32(28)17-20(33)16-31-25-9-5-3-7-21(25)22-8-4-6-10-26(22)31;/h3,5,7,9,11-12,15,20,33H,2,4,6,8,10,13-14,16-18H2,1H3;1H

Standard InChI Key:  WWMLJSNCBKSEIK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    2.1875   -1.7410    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.5240    0.0634    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3388   -0.0657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7903   -0.7604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6134   -0.7123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9845    0.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5349    0.7118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7134    0.6694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1301    1.2527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1732    2.0802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4789    2.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7483    2.1507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7054    1.3266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3949    0.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9403   -0.5203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1430   -0.3066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0704    0.4906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4405   -0.8903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2378   -0.6766    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5958    0.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2815    0.8340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7900    1.4835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6035    1.3716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1873    1.9553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9166    0.6077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4137   -0.0436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5613   -0.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8344   -1.2469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8084   -2.0676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5075   -2.5051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2372   -2.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2615   -1.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9845    1.7416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9520   -2.5250    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  8  7  1  0
  8  3  2  0
  9  8  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 14 13  1  0
 14  2  1  0
 14  9  2  0
 15  2  1  0
 16 15  1  0
 16 17  1  0
 18 16  1  0
 19 18  1  0
 20 19  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  0
 26 25  1  0
 26 20  2  0
 27 26  1  0
 28 27  2  0
 28 19  1  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
 24 33  1  0
 31 34  1  0
M  END

Associated Targets(Human)

BCHE Tclin Butyrylcholinesterase (7174 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 445.58Molecular Weight (Monoisotopic): 445.2529AlogP: 5.05#Rotatable Bonds: 5
Polar Surface Area: 33.33Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.74CX LogP: 5.18CX LogD: 5.09
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -0.94

References

1. Dai J, Dan W, Zhang Y, Wang J..  (2018)  Recent developments on synthesis and biological activities of γ-carboline.,  157  [PMID:30103193] [10.1016/j.ejmech.2018.08.015]

Source