8-(4-(6-methoxybenzo[d]thiazol-2-yl)-1H-1,2,3-triazol-1-yl)octan-1-ol

ID: ALA5278438

Max Phase: Preclinical

Molecular Formula: C18H24N4O2S

Molecular Weight: 360.48

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc2nc(-c3cn(CCCCCCCCO)nn3)sc2c1

Standard InChI:  InChI=1S/C18H24N4O2S/c1-24-14-8-9-15-17(12-14)25-18(19-15)16-13-22(21-20-16)10-6-4-2-3-5-7-11-23/h8-9,12-13,23H,2-7,10-11H2,1H3

Standard InChI Key:  YBSIZIMJPWIBJJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   -5.2767    0.8270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5621    1.2393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8502    0.8273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8502    0.0022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5603   -0.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2767   -0.0015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9913   -0.4140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9913   -1.2393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0655   -0.2528    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5805    0.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0654    1.0823    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7553    0.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3427    1.1292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5212    0.9439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4403    0.1424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2002   -0.1896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2742   -0.2701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9890    0.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7035   -0.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4183    0.1418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1328   -0.2709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8476    0.1414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5621   -0.2713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2768    0.1409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9913   -0.2718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  4  9  1  0
 10  9  1  0
 11 10  2  0
  3 11  1  0
 12 10  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 16 15  1  0
 12 16  2  0
 17 15  1  0
 18 17  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5278438

    ---

Associated Targets(Human)

MAPT Tclin Microtubule-associated protein tau (95507 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 360.48Molecular Weight (Monoisotopic): 360.1620AlogP: 3.90#Rotatable Bonds: 10
Polar Surface Area: 73.06Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.00CX LogP: 4.08CX LogD: 4.08
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.56Np Likeness Score: -1.65

References

1. Wongso H, Ono M, Yamasaki T, Kumata K, Higuchi M, Zhang MR, Fulham MJ, Katsifis A, Keller PA..  (2023)  Synthesis and structure-activity relationship (SAR) studies of 1,2,3-triazole, amide, and ester-based benzothiazole derivatives as potential molecular probes for tau protein.,  14  (5): [PMID:37252097] [10.1039/d2md00358a]

Source