rac-6-(1-Aminooctan-2-yl)-3-(pyridin-3-yl)-5,6-dihydrothieno[2,3-c]pyridin-7(4H)-one

ID: ALA5278471

Max Phase: Preclinical

Molecular Formula: C20H27N3OS

Molecular Weight: 357.52

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCC(CN)N1CCc2c(-c3cccnc3)csc2C1=O

Standard InChI:  InChI=1S/C20H27N3OS/c1-2-3-4-5-8-16(12-21)23-11-9-17-18(14-25-19(17)20(23)24)15-7-6-10-22-13-15/h6-7,10,13-14,16H,2-5,8-9,11-12,21H2,1H3

Standard InChI Key:  GVCQWUUSWMGXSK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    0.7870   -0.0851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7870   -0.9101    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4990   -1.3184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2155   -0.9065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2110   -0.0851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4990    0.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9908    0.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4773   -0.4890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9981   -1.1561    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.2043    0.9697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6211    1.5533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8348    2.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6318    2.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2134    1.9818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0046    1.1842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4994   -2.1434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0731   -1.3236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6418   -0.9122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0731   -2.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6412   -2.5611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3557   -1.3257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0707   -0.9142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7845   -1.3277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4995   -0.9163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2134   -1.3298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  4  2  0
  5  6  1  0
  1  6  1  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  1  0
 10  7  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 10 15  1  0
  3 16  2  0
  2 17  1  0
 17 18  1  0
 17 19  1  0
 19 20  1  0
 21 18  1  0
 22 21  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5278471

    ---

Associated Targets(Human)

DHPS Tchem Deoxyhypusine synthase (182 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 357.52Molecular Weight (Monoisotopic): 357.1875AlogP: 4.11#Rotatable Bonds: 8
Polar Surface Area: 59.22Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.18CX LogP: 3.57CX LogD: 1.81
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.72Np Likeness Score: -0.50

References

1. Tanaka Y, Kurasawa O, Yokota A, Klein MG, Saito B, Matsumoto S, Okaniwa M, Ambrus-Aikelin G, Uchiyama N, Morishita D, Kimura H, Imamura S..  (2020)  New Series of Potent Allosteric Inhibitors of Deoxyhypusine Synthase.,  11  (8.0): [PMID:34345355] [10.1021/acsmedchemlett.0c00331]

Source