5-(2,4-dihydroxy-5-isopropylphenyl)-N-ethyl-4-(4-(morpholinomethyl)phenyl)furan-3-carboxamide

ID: ALA5278498

Max Phase: Preclinical

Molecular Formula: C27H32N2O5

Molecular Weight: 464.56

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCNC(=O)c1coc(-c2cc(C(C)C)c(O)cc2O)c1-c1ccc(CN2CCOCC2)cc1

Standard InChI:  InChI=1S/C27H32N2O5/c1-4-28-27(32)22-16-34-26(21-13-20(17(2)3)23(30)14-24(21)31)25(22)19-7-5-18(6-8-19)15-29-9-11-33-12-10-29/h5-8,13-14,16-17,30-31H,4,9-12,15H2,1-3H3,(H,28,32)

Standard InChI Key:  FFAFAEOJCRQNBO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   -2.2551   -0.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5405   -0.0764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8287   -0.4883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8287   -1.3134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5387   -1.7253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2551   -1.3172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5405    0.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2552    1.1613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8259    1.1613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9698   -0.0762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5387   -2.5505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1140   -1.7261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6005   -1.3134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2192   -1.8849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8886   -2.6194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0644   -2.5271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0163   -1.6713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2299   -0.8742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5998   -2.2548    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3861   -3.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9698   -3.6353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6005   -0.4883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1139   -0.0755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1131    0.7471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6016    1.1598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3134    0.7506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3182   -0.0740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6016    1.9850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3162    2.3975    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3162    3.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0308    3.6353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7454    3.2228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7454    2.3975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0308    1.9850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  2  7  1  0
  7  8  1  0
  7  9  1  0
  1 10  1  0
  5 11  1  0
  4 12  1  0
 13 12  2  0
 13 14  1  0
 14 15  2  0
 16 15  1  0
 12 16  1  0
 14 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 13 22  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 22 27  1  0
 25 28  1  0
 28 29  1  0
 30 29  1  0
 31 30  1  0
 32 31  1  0
 33 32  1  0
 34 33  1  0
 29 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5278498

    ---

Associated Targets(Human)

NCI-H522 (44358 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SK-OV-3 (52876 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
UO-31 (46270 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.56Molecular Weight (Monoisotopic): 464.2311AlogP: 4.73#Rotatable Bonds: 7
Polar Surface Area: 95.17Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.72CX Basic pKa: 7.10CX LogP: 3.99CX LogD: 3.92
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: -0.17

References

1. Mishra SJ, Reynolds TS, Merfeld T, Balch M, Peng S, Deng J, Matts R, Blagg BSJ..  (2022)  Structure-Activity Relationship Study of Tertiary Alcohol Hsp90α-Selective Inhibitors with Novel Binding Mode.,  13  (12.0): [PMID:36518703] [10.1021/acsmedchemlett.2c00327]

Source