The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2Z)-2-{[3-(1-benzyl-1H-indol-3-yl)-1-(3-chlorophenyl)-1H-pyrazol-5-yl]imino}-1,3-thiazolidin-4-one ID: ALA5278629
Max Phase: Preclinical
Molecular Formula: C27H20ClN5OS
Molecular Weight: 498.01
Associated Items:
Names and Identifiers Canonical SMILES: O=C1CS/C(=N\c2cc(-c3cn(Cc4ccccc4)c4ccccc34)nn2-c2cccc(Cl)c2)N1
Standard InChI: InChI=1S/C27H20ClN5OS/c28-19-9-6-10-20(13-19)33-25(29-27-30-26(34)17-35-27)14-23(31-33)22-16-32(15-18-7-2-1-3-8-18)24-12-5-4-11-21(22)24/h1-14,16H,15,17H2,(H,29,30,34)
Standard InChI Key: RYFAGLFXRLWQSM-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
-0.1768 1.2716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6481 1.2716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8983 0.4676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2447 -0.0030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4226 0.4888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6950 0.2541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9085 -0.5425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7051 -0.7560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7387 -1.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9858 -1.8825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4685 -1.2348 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.4529 -2.0095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2194 0.2754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4328 -0.5212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2739 -0.5547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5593 0.1981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9116 0.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3286 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4529 1.3197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8096 1.8358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0364 1.5384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0606 1.9859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6484 2.7004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0602 3.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8852 3.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2970 2.7022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8889 1.9859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6863 -1.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2739 -1.9833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4490 -1.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0386 -2.6961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4511 -3.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2718 -3.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6881 -2.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1217 2.7022 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
1 5 2 0
5 4 1 0
3 6 1 0
6 7 2 0
8 7 1 0
8 9 1 0
9 10 1 0
11 10 1 0
7 11 1 0
9 12 2 0
5 13 1 0
14 13 2 0
14 15 1 0
15 16 1 0
17 16 2 0
13 17 1 0
16 18 1 0
19 18 2 0
20 19 1 0
21 20 2 0
17 21 1 0
2 22 1 0
23 22 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
22 27 1 0
15 28 1 0
28 29 1 0
30 29 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
29 34 1 0
26 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.01Molecular Weight (Monoisotopic): 497.1077AlogP: 6.05#Rotatable Bonds: 5Polar Surface Area: 64.21Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.57CX Basic pKa: 0.72CX LogP: 6.64CX LogD: 6.42Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.32Np Likeness Score: -1.53
References 1. Soni JP, Chilvery S, Sharma A, Reddy GN, Godugu C, Shankaraiah N.. (2023) Design, synthesis and in vitro cytotoxicity evaluation of indolo-pyrazoles grafted with thiazolidinone as tubulin polymerization inhibitors., 14 (3): [PMID:36970141 ] [10.1039/d2md00442a ]