(E)-2-((2-hydroxy-3-methoxybenzylidene)amino)-1H-benzo[de]isoquinoline-1,3(2H)-dione

ID: ALA5278652

Max Phase: Preclinical

Molecular Formula: C20H14N2O4

Molecular Weight: 346.34

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(/C=N/N2C(=O)c3cccc4cccc(c34)C2=O)c1O

Standard InChI:  InChI=1S/C20H14N2O4/c1-26-16-10-4-7-13(18(16)23)11-21-22-19(24)14-8-2-5-12-6-3-9-15(17(12)14)20(22)25/h2-11,23H,1H3/b21-11+

Standard InChI Key:  PTOBQOTVXAVVTH-SRZZPIQSSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
    3.3133   -0.6828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8849    0.0221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0557    0.0221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6564   -0.7185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0854   -1.4282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9179   -1.4282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8325   -0.7185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4339   -1.4584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4050   -0.0263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8006    0.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6282    0.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0280    1.4584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8530    1.4584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2863    0.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3727    1.4020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4217   -0.0263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8351    0.6896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6618    0.6896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0755   -0.0255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8998   -0.0255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3133    0.6906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9033    1.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0770    1.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3132   -0.7415    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8998   -1.4576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6621   -0.7423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  4  7  1  0
  7  8  2  0
  9  7  1  0
 10  9  1  0
 11 10  1  0
  3 11  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
  2 14  1  0
 10 15  2  0
  9 16  1  0
 16 17  2  0
 17 18  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 18 23  1  0
 20 24  1  0
 24 25  1  0
 19 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5278652

    ---

Associated Targets(non-human)

Calf thymus DNA (4845 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 346.34Molecular Weight (Monoisotopic): 346.0954AlogP: 3.18#Rotatable Bonds: 3
Polar Surface Area: 79.20Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.25CX Basic pKa: CX LogP: 3.36CX LogD: 3.35
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.58Np Likeness Score: -0.50

References

1. Tomczyk MD, Walczak KZ..  (2018)  l,8-Naphthalimide based DNA intercalators and anticancer agents. A systematic review from 2007 to 2017.,  159  [PMID:30312931] [10.1016/j.ejmech.2018.09.055]

Source