5-((4R,5R)-5-(4-fluorophenyl)-4-methyl-2-oxooxazolidin-3-yl)isophthalonitrile

ID: ALA5278664

Max Phase: Preclinical

Molecular Formula: C18H12FN3O2

Molecular Weight: 321.31

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H]1[C@@H](c2ccc(F)cc2)OC(=O)N1c1cc(C#N)cc(C#N)c1

Standard InChI:  InChI=1S/C18H12FN3O2/c1-11-17(14-2-4-15(19)5-3-14)24-18(23)22(11)16-7-12(9-20)6-13(8-16)10-21/h2-8,11,17H,1H3/t11-,17+/m1/s1

Standard InChI Key:  NJAIJURIMBUHLD-DIFFPNOSSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   -2.6807   -0.7133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0929    0.0013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6810    0.7133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8556    0.7133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4438    0.0031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8519   -0.7133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6184    0.0031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1336    0.6705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6508    0.4155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6508   -0.4092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1336   -0.6641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3652   -0.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0797   -0.4094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7915   -0.8212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7915   -1.6463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0816   -2.0581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3652   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0930   -1.4276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0934    1.4277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5058    2.1420    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5055   -2.1420    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3471    1.4672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3471   -1.4609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5058   -2.0588    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  7  5  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 11  7  1  0
 10 11  1  0
 10 12  1  6
 13 12  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 12 17  1  0
  1 18  1  0
  3 19  1  0
 19 20  3  0
 18 21  3  0
  8 22  2  0
 11 23  1  1
 15 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5278664

    ---

Associated Targets(Human)

FADS1 Tchem Fatty acid desaturase 1 (145 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 321.31Molecular Weight (Monoisotopic): 321.0914AlogP: 3.66#Rotatable Bonds: 2
Polar Surface Area: 77.12Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.58CX LogD: 3.58
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.85Np Likeness Score: -0.38

References

1. Fernandes GFS, Scarim CB, Kim SH, Wu J, Castagnolo D..  (2023)  Oxazolidinones as versatile scaffolds in medicinal chemistry.,  14  (5): [PMID:37252095] [10.1039/d2md00415a]

Source