12-chloro-11-Hydroxydibromoisophakellin

ID: ALA5278708

Max Phase: Preclinical

Molecular Formula: C11H12Br2ClN5O2

Molecular Weight: 441.51

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC1NC2c3c([nH]c(Br)c3Br)C(=O)N3C[C@H](Cl)[C@H](O)C23N1

Standard InChI:  InChI=1S/C11H12Br2ClN5O2/c12-4-3-5(16-8(4)13)9(21)19-1-2(14)7(20)11(19)6(3)17-10(15)18-11/h2,6-7,10,16-18,20H,1,15H2/t2-,6?,7-,10?,11?/m0/s1

Standard InChI Key:  NOTKSCQGGVKVIP-GAQQAGHNSA-N

Molfile:  

 
     RDKit          2D

 21 24  0  0  0  0  0  0  0  0999 V2000
   -0.0244    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0244   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6899   -0.8249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4043   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4043    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6899    0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8614    1.6317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6818    1.7178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0173    0.9643    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0941    2.4321    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    0.2783    2.2149    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    2.1184   -0.8247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5184   -1.6317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3020   -1.7178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6374   -0.9643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4340   -1.1777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7143   -2.4321    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.8089   -0.6673    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2938    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8089    0.6673    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1184    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  1  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  5  9  1  0
  8 10  1  0
  7 11  1  0
  4 12  2  0
  3 13  1  0
 13 14  1  0
 14 15  1  0
  2 15  1  0
 15 16  1  6
 14 17  1  6
  2 18  1  0
 18 19  1  0
 19 20  1  0
  1 20  1  0
 19 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5278708

    ---

Associated Targets(non-human)

L1210 (27553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 441.51Molecular Weight (Monoisotopic): 438.9046AlogP: 0.15#Rotatable Bonds:
Polar Surface Area: 106.41Molecular Species: NEUTRALHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.39CX Basic pKa: 5.53CX LogP: 0.82CX LogD: 0.81
Aromatic Rings: 1Heavy Atoms: 21QED Weighted: 0.37Np Likeness Score: 1.69

References

1. Mahamed S, Motal R, Govender T, Dlamini N, Khuboni K, Hadeb Z, Shaik BB, Moodley K, Balaso Mohite S, Karpoormath R..  (2023)  A concise review on marine bromopyrrole alkaloids as anticancer agents.,  80  [PMID:36496202] [10.1016/j.bmcl.2022.129102]

Source