30-methy-loscillatoxin D

ID: ALA5278753

Max Phase: Preclinical

Molecular Formula: C32H44O8

Molecular Weight: 556.70

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CO[C@@H](CC[C@H](C)C1O[C@@]2(C=C[C@@H]1C)[C@H](C(=O)O[C@@H]1CC(=O)O[C@@H]1C)C(=O)[C@H](C)CC2(C)C)c1cccc(O)c1

Standard InChI:  InChI=1S/C32H44O8/c1-18(11-12-24(37-7)22-9-8-10-23(33)15-22)29-19(2)13-14-32(40-29)27(28(35)20(3)17-31(32,5)6)30(36)39-25-16-26(34)38-21(25)4/h8-10,13-15,18-21,24-25,27,29,33H,11-12,16-17H2,1-7H3/t18-,19-,20+,21+,24-,25+,27-,29?,32-/m0/s1

Standard InChI Key:  PRHBNKNLOZFUEA-ZCVZNDTASA-N

Molfile:  

 
     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
   -1.8616    1.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8616    1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1472    0.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4327    1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4327    1.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1472    2.2678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1472    3.0925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0196    0.3147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3919    1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4330    0.2055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4330   -0.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1472   -1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8614   -0.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8614    0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1472   -1.8563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2812   -1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9955   -0.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7097   -1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4240   -0.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1382   -1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8526   -0.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5643   -1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5643   -1.8561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8544   -2.2678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1382   -1.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8544   -3.0925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4240    0.2055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7097    0.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2812   -1.8563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5758    0.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5758   -0.2067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2901   -0.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2901   -1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0938   -1.6938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5643   -1.0405    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0726   -0.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2860    0.4232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3073   -2.4904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2901    1.0303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5758    2.2677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  6  7  1  6
  4  8  1  0
  4  9  1  0
  3 10  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
 14 13  2  0
  3 14  1  6
 12 15  1  1
 11 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 20 25  1  0
 24 26  1  0
 19 27  1  6
 27 28  1  0
 16 29  1  6
  2 30  1  6
 30 31  1  0
 32 31  1  6
 33 32  1  0
 33 34  1  0
 34 35  1  0
 36 35  1  0
 32 36  1  0
 36 37  1  6
 34 38  2  0
 30 39  2  0
  1 40  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5278753

    ---

Associated Targets(non-human)

L1210 (27553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Nitzschia amabilis (14 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 556.70Molecular Weight (Monoisotopic): 556.3036AlogP: 5.32#Rotatable Bonds: 8
Polar Surface Area: 108.36Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.36CX Basic pKa: CX LogP: 6.05CX LogD: 6.04
Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.26Np Likeness Score: 1.71

References

1. Xu J, Zhang T, Yao J, Lu J, Liu Z, Ding L..  (2020)  Recent advances in chemistry and bioactivity of marine cyanobacteria Moorea species.,  201  [PMID:32652435] [10.1016/j.ejmech.2020.112473]

Source