The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
30-methy-loscillatoxin D ID: ALA5278753
Max Phase: Preclinical
Molecular Formula: C32H44O8
Molecular Weight: 556.70
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@@H](CC[C@H](C)C1O[C@@]2(C=C[C@@H]1C)[C@H](C(=O)O[C@@H]1CC(=O)O[C@@H]1C)C(=O)[C@H](C)CC2(C)C)c1cccc(O)c1
Standard InChI: InChI=1S/C32H44O8/c1-18(11-12-24(37-7)22-9-8-10-23(33)15-22)29-19(2)13-14-32(40-29)27(28(35)20(3)17-31(32,5)6)30(36)39-25-16-26(34)38-21(25)4/h8-10,13-15,18-21,24-25,27,29,33H,11-12,16-17H2,1-7H3/t18-,19-,20+,21+,24-,25+,27-,29?,32-/m0/s1
Standard InChI Key: PRHBNKNLOZFUEA-ZCVZNDTASA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
-1.8616 1.8553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8616 1.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1472 0.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4327 1.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4327 1.8553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1472 2.2678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1472 3.0925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0196 0.3147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3919 1.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4330 0.2055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4330 -0.6191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1472 -1.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8614 -0.6192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8614 0.2054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1472 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2812 -1.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9955 -0.6191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7097 -1.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4240 -0.6191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1382 -1.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8526 -0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5643 -1.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5643 -1.8561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8544 -2.2678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1382 -1.8598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8544 -3.0925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4240 0.2055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7097 0.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2812 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5758 0.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5758 -0.2067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2901 -0.6191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2901 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0938 -1.6938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5643 -1.0405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0726 -0.3733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2860 0.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3073 -2.4904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2901 1.0303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5758 2.2677 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
6 7 1 6
4 8 1 0
4 9 1 0
3 10 1 0
11 10 1 0
12 11 1 0
13 12 1 0
14 13 2 0
3 14 1 6
12 15 1 1
11 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
21 20 2 0
22 21 1 0
23 22 2 0
24 23 1 0
25 24 2 0
20 25 1 0
24 26 1 0
19 27 1 6
27 28 1 0
16 29 1 6
2 30 1 6
30 31 1 0
32 31 1 6
33 32 1 0
33 34 1 0
34 35 1 0
36 35 1 0
32 36 1 0
36 37 1 6
34 38 2 0
30 39 2 0
1 40 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 556.70Molecular Weight (Monoisotopic): 556.3036AlogP: 5.32#Rotatable Bonds: 8Polar Surface Area: 108.36Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.36CX Basic pKa: ┄CX LogP: 6.05CX LogD: 6.04Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.26Np Likeness Score: 1.71
References 1. Xu J, Zhang T, Yao J, Lu J, Liu Z, Ding L.. (2020) Recent advances in chemistry and bioactivity of marine cyanobacteria Moorea species., 201 [PMID:32652435 ] [10.1016/j.ejmech.2020.112473 ]