(S)-(4-((2-((methoxycarbonyl)amino)-N,3-diphenylpropanamido)methyl)phenyl)sulfamic acid

ID: ALA5278831

Max Phase: Preclinical

Molecular Formula: C24H25N3O6S

Molecular Weight: 483.55

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)N[C@@H](Cc1ccccc1)C(=O)N(Cc1ccc(NS(=O)(=O)O)cc1)c1ccccc1

Standard InChI:  InChI=1S/C24H25N3O6S/c1-33-24(29)25-22(16-18-8-4-2-5-9-18)23(28)27(21-10-6-3-7-11-21)17-19-12-14-20(15-13-19)26-34(30,31)32/h2-15,22,26H,16-17H2,1H3,(H,25,29)(H,30,31,32)/t22-/m0/s1

Standard InChI Key:  KTCUAMJSDSJKBN-QFIPXVFZSA-N

Molfile:  

 
     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    3.2669    0.1956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5488   -0.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8380    0.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1199   -0.1977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4092    0.2211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3088   -0.1849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3162   -1.0099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0344   -1.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7451   -0.9971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4632   -1.4032    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1740   -0.9844    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1666   -0.1594    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7377   -0.1722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0196    0.2338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1126   -1.0227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3945   -1.4288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3871   -2.2537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0978   -2.6726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8159   -2.2665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8233   -1.4415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8454    1.0333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9992   -0.9844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3876   -1.7815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2743    1.0243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9926    1.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9992    2.2535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2880    2.6726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5724    2.2698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5603    1.4450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5488   -1.0357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2635   -1.4483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2635   -2.2736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9782   -1.0357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9782   -0.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  9  8  1  0
  9 10  1  0
 11 10  1  0
 11 12  1  0
  9 13  2  0
 13 14  1  0
 14  6  2  0
 15  4  1  0
 15 16  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 20 19  1  0
 15 20  2  0
  3 21  2  0
 11 22  2  0
 11 23  2  0
  1 24  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 24 29  1  0
  2 30  1  6
 30 31  1  0
 31 32  2  0
 31 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5278831

    ---

Associated Targets(Human)

PTPRB Tchem Receptor-type tyrosine-protein phosphatase beta (330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.55Molecular Weight (Monoisotopic): 483.1464AlogP: 3.40#Rotatable Bonds: 9
Polar Surface Area: 125.04Molecular Species: ACIDHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: -1.36CX Basic pKa: CX LogP: 3.03CX LogD: 0.65
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -0.92

References

1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S..  (2020)  Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors.,  28  (23.0): [PMID:32992253] [10.1016/j.bmc.2020.115777]

Source