The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-(4-((2-((methoxycarbonyl)amino)-N,3-diphenylpropanamido)methyl)phenyl)sulfamic acid ID: ALA5278831
Max Phase: Preclinical
Molecular Formula: C24H25N3O6S
Molecular Weight: 483.55
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)N[C@@H](Cc1ccccc1)C(=O)N(Cc1ccc(NS(=O)(=O)O)cc1)c1ccccc1
Standard InChI: InChI=1S/C24H25N3O6S/c1-33-24(29)25-22(16-18-8-4-2-5-9-18)23(28)27(21-10-6-3-7-11-21)17-19-12-14-20(15-13-19)26-34(30,31)32/h2-15,22,26H,16-17H2,1H3,(H,25,29)(H,30,31,32)/t22-/m0/s1
Standard InChI Key: KTCUAMJSDSJKBN-QFIPXVFZSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
3.2669 0.1956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5488 -0.2104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8380 0.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1199 -0.1977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4092 0.2211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3088 -0.1849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3162 -1.0099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0344 -1.4160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7451 -0.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4632 -1.4032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1740 -0.9844 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.1666 -0.1594 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7377 -0.1722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0196 0.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1126 -1.0227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3945 -1.4288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3871 -2.2537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0978 -2.6726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8159 -2.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8233 -1.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8454 1.0333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9992 -0.9844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3876 -1.7815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2743 1.0243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9926 1.4307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9992 2.2535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2880 2.6726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5724 2.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5603 1.4450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5488 -1.0357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2635 -1.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2635 -2.2736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9782 -1.0357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9782 -0.2104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
9 8 1 0
9 10 1 0
11 10 1 0
11 12 1 0
9 13 2 0
13 14 1 0
14 6 2 0
15 4 1 0
15 16 1 0
17 16 2 0
18 17 1 0
19 18 2 0
20 19 1 0
15 20 2 0
3 21 2 0
11 22 2 0
11 23 2 0
1 24 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
2 30 1 6
30 31 1 0
31 32 2 0
31 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.55Molecular Weight (Monoisotopic): 483.1464AlogP: 3.40#Rotatable Bonds: 9Polar Surface Area: 125.04Molecular Species: ACIDHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: -1.36CX Basic pKa: ┄CX LogP: 3.03CX LogD: 0.65Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -0.92
References 1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S.. (2020) Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors., 28 (23.0): [PMID:32992253 ] [10.1016/j.bmc.2020.115777 ]