The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S,E)-2-((4-(3-(4-bromo-2-fluorophenyl)acryloyl)phenyl)amino)-N-(2-oxotetrahydrofuran-3-yl)acetamide ID: ALA5278841
Max Phase: Preclinical
Molecular Formula: C21H18BrFN2O4
Molecular Weight: 461.29
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CNc1ccc(C(=O)/C=C/c2ccc(Br)cc2F)cc1)N[C@H]1CCOC1=O
Standard InChI: InChI=1S/C21H18BrFN2O4/c22-15-5-1-13(17(23)11-15)4-8-19(26)14-2-6-16(7-3-14)24-12-20(27)25-18-9-10-29-21(18)28/h1-8,11,18,24H,9-10,12H2,(H,25,27)/b8-4+/t18-/m0/s1
Standard InChI Key: YOAIJIBGXCVXAN-PYJQOMOHSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
3.4823 0.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4823 -0.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1957 -0.6969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9028 -0.2868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9028 0.5348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1940 0.9451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1940 1.7668 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.6146 -0.6976 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2.7706 0.9453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0589 0.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3472 0.9453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6355 0.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6355 -0.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0745 -0.6962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7864 -0.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7864 0.5322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0791 0.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4980 -0.6961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2098 -0.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9215 -0.6961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6332 -0.2853 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.3449 -0.6961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3449 -1.5179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1457 -1.7671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6146 -1.1161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1246 -0.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3373 0.3424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9215 -1.5179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3472 1.7671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
6 7 1 0
4 8 1 0
1 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
15 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
22 21 1 1
23 22 1 0
23 24 1 0
24 25 1 0
26 25 1 0
22 26 1 0
26 27 2 0
20 28 2 0
11 29 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.29Molecular Weight (Monoisotopic): 460.0434AlogP: 3.33#Rotatable Bonds: 7Polar Surface Area: 84.50Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.90CX Basic pKa: 1.35CX LogP: 2.89CX LogD: 2.89Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.38Np Likeness Score: -0.98
References 1. Ampomah-Wireko M, Luo C, Cao Y, Wang H, Nininahazwe L, Wu C.. (2021) Chemical probe of AHL modulators on quorum sensing in Gram-Negative Bacteria and as antiproliferative agents: A review., 226 [PMID:34626877 ] [10.1016/j.ejmech.2021.113864 ]