N1-(4-(benzylamino)butyl)-N12-(3-(benzylamino)propyl)dodecane-1,12-diamine

ID: ALA5278877

Max Phase: Preclinical

Molecular Formula: C33H56N4

Molecular Weight: 508.84

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc(CNCCCCNCCCCCCCCCCCCNCCCNCc2ccccc2)cc1

Standard InChI:  InChI=1S/C33H56N4/c1(2-4-6-8-16-25-35-28-19-29-37-31-33-22-13-10-14-23-33)3-5-7-15-24-34-26-17-18-27-36-30-32-20-11-9-12-21-32/h9-14,20-23,34-37H,1-8,15-19,24-31H2

Standard InChI Key:  LMOFCTVKBRPGDJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 38  0  0  0  0  0  0  0  0999 V2000
  -10.7182    0.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.0036    0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2918    0.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2918   -0.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.0018   -0.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7182   -0.4150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5771   -0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8624   -0.4113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1479   -0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4332   -0.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7185   -0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0040   -0.4113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2893   -0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5746   -0.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8600   -0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1454   -0.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4307   -0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7161   -0.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0015   -0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7131   -0.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4277   -0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1423   -0.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8570   -0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5716   -0.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2862   -0.8239    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0009   -0.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7155   -0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -0.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1448   -0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8594   -0.4113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5741   -0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2887   -0.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2890    0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0018    0.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7167    0.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7182   -0.4092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0064   -0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 36 35  1  0
 37 36  2  0
 32 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5278877

    ---

Associated Targets(non-human)

Leishmania donovani (89745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 508.84Molecular Weight (Monoisotopic): 508.4505AlogP: 6.82#Rotatable Bonds: 26
Polar Surface Area: 48.12Molecular Species: BASEHBA: 4HBD: 4
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 10.94CX LogP: 6.93CX LogD: -1.50
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.11Np Likeness Score: -0.22

References

1. Jagu E, Pomel S, Pethe S, Loiseau PM, Labruère R..  (2017)  Polyamine-based analogs and conjugates as antikinetoplastid agents.,  139  [PMID:28886510] [10.1016/j.ejmech.2017.08.014]

Source