The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1-(4-(benzylamino)butyl)-N12-(3-(benzylamino)propyl)dodecane-1,12-diamine ID: ALA5278877
Max Phase: Preclinical
Molecular Formula: C33H56N4
Molecular Weight: 508.84
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc(CNCCCCNCCCCCCCCCCCCNCCCNCc2ccccc2)cc1
Standard InChI: InChI=1S/C33H56N4/c1(2-4-6-8-16-25-35-28-19-29-37-31-33-22-13-10-14-23-33)3-5-7-15-24-34-26-17-18-27-36-30-32-20-11-9-12-21-32/h9-14,20-23,34-37H,1-8,15-19,24-31H2
Standard InChI Key: LMOFCTVKBRPGDJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 38 0 0 0 0 0 0 0 0999 V2000
-10.7182 0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.0036 0.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.2918 0.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.2918 -0.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.0018 -0.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.7182 -0.4150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.5771 -0.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8624 -0.4113 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.1479 -0.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4332 -0.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7185 -0.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0040 -0.4113 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2893 -0.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5746 -0.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8600 -0.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1454 -0.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4307 -0.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7161 -0.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0015 -0.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 -0.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4277 -0.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1423 -0.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8570 -0.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5716 -0.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2862 -0.8239 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0009 -0.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7155 -0.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4302 -0.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1448 -0.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8594 -0.4113 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5741 -0.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2887 -0.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2890 0.4138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0018 0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7167 0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7182 -0.4092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0064 -0.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
33 32 2 0
34 33 1 0
35 34 2 0
36 35 1 0
37 36 2 0
32 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.84Molecular Weight (Monoisotopic): 508.4505AlogP: 6.82#Rotatable Bonds: 26Polar Surface Area: 48.12Molecular Species: BASEHBA: 4HBD: 4#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.94CX LogP: 6.93CX LogD: -1.50Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.11Np Likeness Score: -0.22
References 1. Jagu E, Pomel S, Pethe S, Loiseau PM, Labruère R.. (2017) Polyamine-based analogs and conjugates as antikinetoplastid agents., 139 [PMID:28886510 ] [10.1016/j.ejmech.2017.08.014 ]