(4-Hydroxypiperidin-1-yl)(5-methyl-2-(pyridin-4-yl)phenyl)-methanone

ID: ALA5278891

Max Phase: Preclinical

Molecular Formula: C18H20N2O2

Molecular Weight: 296.37

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2ccncc2)c(C(=O)N2CCC(O)CC2)c1

Standard InChI:  InChI=1S/C18H20N2O2/c1-13-2-3-16(14-4-8-19-9-5-14)17(12-13)18(22)20-10-6-15(21)7-11-20/h2-5,8-9,12,15,21H,6-7,10-11H2,1H3

Standard InChI Key:  NVQOOURGCFKWOU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   36.8825  -10.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8813  -11.3370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5941  -11.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3085  -11.3365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3056  -10.5084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5923  -10.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5957  -12.5692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8816  -12.9798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8811  -13.8017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5939  -14.2140    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.3089  -13.7984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3058  -12.9779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5898   -9.2777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1685  -11.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1678  -12.5704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.4564  -11.3359    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.4565  -10.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7483  -10.0973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0332  -10.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0306  -11.3281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7431  -11.7444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3226  -10.0899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
  6 13  1  0
  2 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5278891

    ---

Associated Targets(Human)

CYP46A1 Tchem Cholesterol 24-hydroxylase (289 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 296.37Molecular Weight (Monoisotopic): 296.1525AlogP: 2.65#Rotatable Bonds: 2
Polar Surface Area: 53.43Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.73CX LogP: 1.53CX LogD: 1.53
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.93Np Likeness Score: -0.87

References

1. Koike T, Yoshikawa M, Ando HK, Farnaby W, Nishi T, Watanabe E, Yano J, Miyamoto M, Kondo S, Ishii T, Kuroita T..  (2021)  Discovery of Soticlestat, a Potent and Selective Inhibitor for Cholesterol 24-Hydroxylase (CH24H).,  64  (16.0): [PMID:34387987] [10.1021/acs.jmedchem.1c00864]

Source