The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((4-(2-(1H-benzo[d][1,2,3]triazol-1-yl)-2-(4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl)-5-phenylpent-4-en-1-yl)phenyl)difluoromethyl)phosphonic acid ID: ALA5278919
Max Phase: Preclinical
Molecular Formula: C33H28F2N5O4P
Molecular Weight: 627.59
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1noc(-c2ccc(C(C/C=C/c3ccccc3)(Cc3ccc(C(F)(F)P(=O)(O)O)cc3)n3nnc4ccccc43)cc2)n1
Standard InChI: InChI=1S/C33H28F2N5O4P/c1-23-36-31(44-38-23)26-15-19-27(20-16-26)32(21-7-10-24-8-3-2-4-9-24,40-30-12-6-5-11-29(30)37-39-40)22-25-13-17-28(18-14-25)33(34,35)45(41,42)43/h2-20H,21-22H2,1H3,(H2,41,42,43)/b10-7+
Standard InChI Key: AWPQDTIETWJPSM-JXMROGBWSA-N
Molfile:
RDKit 2D
45 50 0 0 0 0 0 0 0 0999 V2000
-1.7130 -1.7342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9962 -2.1425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2856 -1.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2856 -0.9047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9979 -0.4926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7130 -0.9051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4295 -0.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4295 0.3338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2856 0.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2856 1.5725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0007 1.9853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7160 1.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4286 1.9849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4286 2.8109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7178 3.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0007 2.8146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8431 -1.2083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5970 -1.9917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2651 -2.4841 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9192 -2.0130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6688 -1.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2392 -0.5914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0615 -0.7767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3124 -1.5769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7448 -2.1991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2552 -0.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6681 0.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2554 0.9385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6677 1.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4937 1.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9066 2.3662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9066 3.1935 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.1915 2.7807 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.7324 2.3662 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
4.1452 3.0814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9465 1.5671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5297 2.1516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9059 0.9403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4974 0.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4282 -2.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4282 -2.9728 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2328 -3.2232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7040 -2.5690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2116 -1.9010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.5297 -2.5690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
12 11 2 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 2 0
11 16 1 0
7 17 1 0
17 18 1 0
18 19 2 0
20 19 1 0
21 20 2 0
21 17 1 0
21 22 1 0
23 22 2 0
24 23 1 0
25 24 2 0
20 25 1 0
7 26 1 0
26 27 1 0
28 27 2 0
29 28 1 0
30 29 2 0
30 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
34 35 1 0
34 36 2 0
34 37 1 0
38 30 1 0
39 38 2 0
27 39 1 0
40 1 1 0
40 41 1 0
41 42 1 0
42 43 2 0
44 43 1 0
40 44 2 0
43 45 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 627.59Molecular Weight (Monoisotopic): 627.1847AlogP: 7.11#Rotatable Bonds: 10Polar Surface Area: 127.16Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 0.76CX Basic pKa: 0.19CX LogP: 6.63CX LogD: 4.55Aromatic Rings: 6Heavy Atoms: 45QED Weighted: 0.15Np Likeness Score: -0.84
References 1. Kousaxidis A, Petrou A, Lavrentaki V, Fesatidou M, Nicolaou I, Geronikaki A.. (2020) Aldose reductase and protein tyrosine phosphatase 1B inhibitors as a promising therapeutic approach for diabetes mellitus., 207 [PMID:32871344 ] [10.1016/j.ejmech.2020.112742 ]