(-)-N,N'-(((2R,2aS,4aS,6R,6aS)-2,6-dimethylhexahydro-1,3,5-trioxa-2a1-azacyclopenta[cd]pentalene-2,6-diyl)bis(methylene))bis(octane-1-sulfonamide)

ID: ALA5278966

Max Phase: Preclinical

Molecular Formula: C26H51N3O7S2

Molecular Weight: 581.84

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCS(=O)(=O)NC[C@@]1(C)O[C@H]2CO[C@@H]3N2[C@H]1O[C@]3(C)CNS(=O)(=O)CCCCCCCC

Standard InChI:  InChI=1S/C26H51N3O7S2/c1-5-7-9-11-13-15-17-37(30,31)27-20-25(3)23-29-22(19-34-23)35-26(4,24(29)36-25)21-28-38(32,33)18-16-14-12-10-8-6-2/h22-24,27-28H,5-21H2,1-4H3/t22-,23-,24-,25+,26+/m0/s1

Standard InChI Key:  RATYEQBHVVOPSV-QWDLEPIUSA-N

Molfile:  

 
     RDKit          2D

 41 43  0  0  0  0  0  0  0  0999 V2000
    0.2076    1.9236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2897    1.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1452    0.6071    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9407    0.8540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9407    1.6145    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6737    1.9236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2022    1.2653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7360    0.6071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3832    2.7265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5292    2.7265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7360   -0.2273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4570    0.1898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0125    1.6827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0125    0.8497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0138    0.0167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4575   -0.6438    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3950    2.3401    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5138    2.3401    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9407    0.0210    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1789   -0.2273    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7360   -0.3986    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4568    0.0191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9003   -0.6438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1533   -1.1213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3193   -1.1213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5961    0.4953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7631    0.4953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1789   -0.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8996    0.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6217   -0.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3425    0.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0646   -0.3914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7854    0.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5075   -0.3891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6218   -0.2273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3432   -0.6438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0646   -0.2273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7861   -0.6438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7861   -1.4769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5075   -1.8934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5075   -2.7265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  5  1  1  0
  5  6  1  0
  6  7  1  0
  4  8  1  0
  7  8  1  0
  6  9  1  0
 10  9  1  0
  1 10  1  0
  8 11  1  0
  8 12  1  1
  2 13  1  1
  2 14  1  0
 14 15  1  0
 11 16  1  0
  6 17  1  1
  1 18  1  1
  4 19  1  1
 16 20  1  0
 15 21  1  0
 21 22  1  0
 20 23  1  0
 21 24  2  0
 21 25  2  0
 20 26  2  0
 20 27  2  0
 22 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 23 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5278966

    ---

Associated Targets(Human)

HCRTR2 Tclin Orexin receptor 2 (5902 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCRTR1 Tclin Orexin receptor 1 (5435 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 581.84Molecular Weight (Monoisotopic): 581.3168AlogP: 3.43#Rotatable Bonds: 20
Polar Surface Area: 123.27Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.96CX Basic pKa: CX LogP: 4.74CX LogD: 4.73
Aromatic Rings: Heavy Atoms: 38QED Weighted: 0.21Np Likeness Score: 0.08

References

1. Amezawa M, Yamamoto N, Nagumo Y, Kutsumura N, Ishikawa Y, Yanagisawa M, Nagase H, Saitoh T..  (2023)  Design and synthesis of novel orexin 2 receptor agonists with a 1,3,5‑trioxazatriquinane skeleton.,  82  [PMID:36690040] [10.1016/j.bmcl.2023.129151]

Source