The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-((1-(6-(benzylamino)pyrimidin-4-yl)-3-hydroxypiperidin-3-yl)methyl)-4-((4,4-dimethylpiperidin-1-yl)methyl)-2-hydroxybenzamide ID: ALA5279050
Max Phase: Preclinical
Molecular Formula: C32H42N6O3
Molecular Weight: 558.73
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CCN(Cc2ccc(C(=O)NC[C@]3(O)CCCN(c4cc(NCc5ccccc5)ncn4)C3)c(O)c2)CC1
Standard InChI: InChI=1S/C32H42N6O3/c1-31(2)12-15-37(16-13-31)20-25-9-10-26(27(39)17-25)30(40)34-21-32(41)11-6-14-38(22-32)29-18-28(35-23-36-29)33-19-24-7-4-3-5-8-24/h3-5,7-10,17-18,23,39,41H,6,11-16,19-22H2,1-2H3,(H,34,40)(H,33,35,36)/t32-/m1/s1
Standard InChI Key: PWYRDVXYAOGDNK-JGCGQSQUSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
-6.1271 0.8054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3020 0.8054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7146 1.5199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4410 0.8013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4421 -0.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7274 -0.4389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0109 -0.0255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0137 0.8049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7291 1.2141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2957 -0.4369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3009 1.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1570 -0.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8711 -0.0249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8711 0.7997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5810 1.2127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3009 -0.0216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5863 -0.4390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4151 0.8103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3040 2.0451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4089 2.4603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1249 2.0505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1238 1.2254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8357 0.8156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5511 1.2273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5500 2.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8335 2.4676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8369 -0.0066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1207 -0.4185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1203 -1.2426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8354 -1.6560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5522 -1.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5491 -0.4162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2681 -1.6491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9812 -1.2341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6971 -1.6441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6979 -2.4663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4130 -2.8763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1270 -2.4612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1215 -1.6320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4059 -1.2257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1187 2.8762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
8 11 1 0
5 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 2 1 0
2 16 1 0
13 17 1 0
16 17 1 0
11 18 2 0
11 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
21 26 1 0
25 26 1 0
23 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
31 33 1 0
33 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
21 41 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 558.73Molecular Weight (Monoisotopic): 558.3318AlogP: 4.18#Rotatable Bonds: 9Polar Surface Area: 113.85Molecular Species: BASEHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.59CX Basic pKa: 9.10CX LogP: 3.80CX LogD: 3.50Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.31Np Likeness Score: -0.86