ID: ALA5279068

Max Phase: Preclinical

Molecular Formula: C19H18FN5O2

Molecular Weight: 367.38

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H]1Nc2ccc3ncc(n3n2)C(=O)NC2(CC2)COc2ccc(F)cc21

Standard InChI:  InChI=1S/C19H18FN5O2/c1-11-13-8-12(20)2-3-15(13)27-10-19(6-7-19)23-18(26)14-9-21-17-5-4-16(22-11)24-25(14)17/h2-5,8-9,11H,6-7,10H2,1H3,(H,22,24)(H,23,26)/t11-/m0/s1

Standard InChI Key:  OSOHXUSZEVLQCS-NSHDSACASA-N

Molfile:  

 
     RDKit          2D

 27 31  0  0  0  0  0  0  0  0999 V2000
   -2.4331    2.9270    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7170    2.5173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7170    1.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9978    1.2827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8723    0.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2820   -0.2486    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8666   -0.9614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0417   -0.9614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3735   -1.6710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0255   -2.3870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6716   -2.9326    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4151   -2.4638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1676   -1.7018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6081   -0.9518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1928   -0.2389    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6025    0.4771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1872    1.1899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3623    1.1899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2850    1.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2850    2.5229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0043    2.9326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4331   -0.9518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8610   -2.3870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2763   -1.6775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0752    0.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3185    0.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3185    0.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  2  0
  3  4  1  0
  5  4  1  0
  6  5  1  0
  7  6  1  0
  8  7  2  0
  9  8  1  0
 10  9  1  0
 10 11  2  0
 12 11  1  0
 13 12  2  0
  9 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
  4 19  2  0
 19 20  1  0
 20 21  2  0
 21  2  1  0
 14 22  2  0
 23 10  1  0
 24 23  2  0
  7 24  1  0
  5 25  1  6
 16 26  1  0
 26 27  1  0
 16 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5279068

    ---

Associated Targets(Human)

ALK Tclin ALK tyrosine kinase receptor (7132 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 367.38Molecular Weight (Monoisotopic): 367.1445AlogP: 2.70#Rotatable Bonds:
Polar Surface Area: 80.55Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.55CX LogP: 2.06CX LogD: 2.06
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.64Np Likeness Score: -0.56

References

1. Xiao X, Xu Y, Yu X, Chen Y, Zhao W, Xie Z, Zhu X, Xu H, Yang Y, Zhang P..  (2023)  Discovery of imidazo[1,2-b]pyridazine macrocyclic derivatives as novel ALK inhibitors capable of combating multiple resistant mutants.,  89  [PMID:37127101] [10.1016/j.bmcl.2023.129309]

Source