The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-hydroxy-4,5-dimethoxy-3-(((2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-9H-xanthen-9-one ID: ALA5279086
Max Phase: Preclinical
Molecular Formula: C21H22O11
Molecular Weight: 450.40
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc2c(=O)c3c(O)cc(O[C@H]4O[C@@H](CO)[C@H](O)[C@H](O)[C@@H]4O)c(OC)c3oc12
Standard InChI: InChI=1S/C21H22O11/c1-28-10-5-3-4-8-14(24)13-9(23)6-11(19(29-2)20(13)32-18(8)10)30-21-17(27)16(26)15(25)12(7-22)31-21/h3-6,12,15-17,21-23,25-27H,7H2,1-2H3/t12-,15-,16-,17-,21-/m0/s1
Standard InChI Key: XLMSZNWYLZCTEQ-YRDWMISXSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-4.2856 1.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5711 1.4442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5711 0.6192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8593 0.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1448 0.6199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4304 0.2073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7178 0.6181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7178 1.4431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4323 1.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0012 0.2057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7132 0.6182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4276 0.2057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4276 -0.6192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7132 -1.0317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1421 -1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1421 -1.8567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8565 -0.6192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5711 -1.0317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8565 0.2057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5711 0.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2856 0.2057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1421 0.6182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0012 -0.6151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7127 -1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7127 -1.8566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4304 -0.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1448 -1.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1448 -1.8551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8593 -0.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5693 -1.0293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2856 -0.6213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2856 0.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
4 5 1 0
6 5 1 0
6 7 1 0
7 8 1 0
8 9 1 0
10 7 2 0
10 11 1 0
12 11 1 1
12 13 1 0
13 14 1 6
13 15 1 0
15 16 1 6
15 17 1 0
17 18 1 6
17 19 1 0
19 20 1 1
20 21 1 0
19 22 1 0
22 12 1 0
23 10 1 0
24 23 2 0
24 25 1 0
26 24 1 0
26 6 2 0
27 26 1 0
27 28 2 0
29 27 1 0
29 4 2 0
30 29 1 0
31 30 2 0
32 31 1 0
3 32 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.40Molecular Weight (Monoisotopic): 450.1162AlogP: -0.15#Rotatable Bonds: 5Polar Surface Area: 168.28Molecular Species: NEUTRALHBA: 11HBD: 5#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.80CX Basic pKa: ┄CX LogP: 0.42CX LogD: 0.40Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.33Np Likeness Score: 1.93