1-hydroxy-4,5-dimethoxy-3-(((2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-9H-xanthen-9-one

ID: ALA5279086

Max Phase: Preclinical

Molecular Formula: C21H22O11

Molecular Weight: 450.40

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc2c(=O)c3c(O)cc(O[C@H]4O[C@@H](CO)[C@H](O)[C@H](O)[C@@H]4O)c(OC)c3oc12

Standard InChI:  InChI=1S/C21H22O11/c1-28-10-5-3-4-8-14(24)13-9(23)6-11(19(29-2)20(13)32-18(8)10)30-21-17(27)16(26)15(25)12(7-22)31-21/h3-6,12,15-17,21-23,25-27H,7H2,1-2H3/t12-,15-,16-,17-,21-/m0/s1

Standard InChI Key:  XLMSZNWYLZCTEQ-YRDWMISXSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -4.2856    1.8567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5711    1.4442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5711    0.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8593    0.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1448    0.6199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4304    0.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7178    0.6181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7178    1.4431    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4323    1.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0012    0.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7132    0.6182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4276    0.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4276   -0.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7132   -1.0317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1421   -1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1421   -1.8567    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8565   -0.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5711   -1.0317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8565    0.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5711    0.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2856    0.2057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1421    0.6182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0012   -0.6151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7127   -1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7127   -1.8566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4304   -0.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1448   -1.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1448   -1.8551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8593   -0.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5693   -1.0293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2856   -0.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2856    0.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  4  5  1  0
  6  5  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
 10  7  2  0
 10 11  1  0
 12 11  1  1
 12 13  1  0
 13 14  1  6
 13 15  1  0
 15 16  1  6
 15 17  1  0
 17 18  1  6
 17 19  1  0
 19 20  1  1
 20 21  1  0
 19 22  1  0
 22 12  1  0
 23 10  1  0
 24 23  2  0
 24 25  1  0
 26 24  1  0
 26  6  2  0
 27 26  1  0
 27 28  2  0
 29 27  1  0
 29  4  2  0
 30 29  1  0
 31 30  2  0
 32 31  1  0
  3 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5279086

    ---

Associated Targets(non-human)

MAL12 Alpha-glucosidase (187 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.40Molecular Weight (Monoisotopic): 450.1162AlogP: -0.15#Rotatable Bonds: 5
Polar Surface Area: 168.28Molecular Species: NEUTRALHBA: 11HBD: 5
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.80CX Basic pKa: CX LogP: 0.42CX LogD: 0.40
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.33Np Likeness Score: 1.93

References

1. Santos CMM, Freitas M, Fernandes E..  (2018)  A comprehensive review on xanthone derivatives as α-glucosidase inhibitors.,  157  [PMID:30282319] [10.1016/j.ejmech.2018.07.073]

Source