The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1-methyl-N2-(3-(5-methyl-4-(4-(methylsulfonyl)phenyl)-6-(tetrahydro-2H-pyran-4-ylamino)pyrimidin-2-yl)benzyl)ethane-1,2-diamine ID: ALA5279093
Max Phase: Preclinical
Molecular Formula: C27H35N5O3S
Molecular Weight: 509.68
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNCCNCc1cccc(-c2nc(NC3CCOCC3)c(C)c(-c3ccc(S(C)(=O)=O)cc3)n2)c1
Standard InChI: InChI=1S/C27H35N5O3S/c1-19-25(21-7-9-24(10-8-21)36(3,33)34)31-27(32-26(19)30-23-11-15-35-16-12-23)22-6-4-5-20(17-22)18-29-14-13-28-2/h4-10,17,23,28-29H,11-16,18H2,1-3H3,(H,30,31,32)
Standard InChI Key: ZGPKKFATQBXLFS-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
26.0304 -20.6650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8199 -21.4575 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
26.6114 -21.2435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4585 -20.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4573 -21.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1654 -21.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8750 -21.0713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8722 -20.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1636 -19.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7507 -19.8438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0430 -20.2526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5784 -19.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2849 -20.2463 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9905 -19.8358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9879 -19.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2737 -18.6120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5709 -19.0249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6935 -18.6055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2677 -17.7948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5571 -17.3914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5536 -16.5724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8470 -16.1690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1399 -16.5793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1439 -17.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8551 -17.8053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6971 -20.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6985 -21.0582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4067 -21.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1140 -21.0534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1087 -20.2320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3999 -19.8295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3352 -19.8442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6276 -20.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9198 -19.8445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2122 -20.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8274 -22.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
4 10 1 0
10 11 1 0
8 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
15 18 1 0
16 19 1 0
19 20 1 0
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
14 26 1 0
11 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
29 2 1 0
2 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.68Molecular Weight (Monoisotopic): 509.2461AlogP: 3.42#Rotatable Bonds: 10Polar Surface Area: 105.24Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.60CX LogP: 3.01CX LogD: 0.81Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.36Np Likeness Score: -1.00
References 1. Zhang Z, Guo Z, Xu X, Cao D, Yang H, Li Y, Shi Q, Du Z, Guo X, Wang X, Chen D, Zhang Y, Chen L, Zhou K, Li J, Geng M, Huang X, Xiong B.. (2021) Structure-Based Discovery of Potent CARM1 Inhibitors for Solid Tumor and Cancer Immunology Therapy., 64 (22.0): [PMID:34781683 ] [10.1021/acs.jmedchem.1c01308 ]