6-bromo-1-(1H-pyrrol-1-yl)-2,3,4,9-tetrahydro-1H-carbazole

ID: ALA5279134

Max Phase: Preclinical

Molecular Formula: C16H15BrN2

Molecular Weight: 315.21

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Brc1ccc2[nH]c3c(c2c1)CCCC3n1cccc1

Standard InChI:  InChI=1S/C16H15BrN2/c17-11-6-7-14-13(10-11)12-4-3-5-15(16(12)18-14)19-8-1-2-9-19/h1-2,6-10,15,18H,3-5H2

Standard InChI Key:  DSXSCWMFRNQSCG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 19 22  0  0  0  0  0  0  0  0999 V2000
   -2.1033    0.6253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3887    1.0376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6768    0.6257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6768   -0.1994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3869   -0.6111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1033   -0.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1079   -0.4543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1079    0.8807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5929    0.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4436    1.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2643    1.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7492    1.0530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4136    0.2992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8261   -0.4153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6464   -0.5014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8179   -1.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1036   -1.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4907   -1.1688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8179    1.0379    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  1  0
  3  8  1  0
  8  9  2  0
  9  7  1  0
  8 10  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
  9 13  1  0
 14 13  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 14  1  0
  1 19  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5279134

    ---

Associated Targets(Human)

DHODH Tclin Dihydroorotate dehydrogenase (2737 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 315.21Molecular Weight (Monoisotopic): 314.0419AlogP: 4.66#Rotatable Bonds: 1
Polar Surface Area: 20.72Molecular Species: NEUTRALHBA: 1HBD: 1
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.78CX LogD: 4.78
Aromatic Rings: 3Heavy Atoms: 19QED Weighted: 0.67Np Likeness Score: -0.38

References

1. Baiazitov RY, Qi H, Arasu T, Lennox W, Cao L, Weetall M, Furia B, Zhuo J, Choi S, Kim MJ, Sheedy J, Davis T, Moon YC..  (2022)  SAR studies toward discovery of emvododstat (PTC299), a potent dihydroorotate dehydrogenase (DHODH) inhibitor.,  244  [PMID:36242990] [10.1016/j.ejmech.2022.114826]

Source