(R)-2-((5aS,6S,8S,9aS,10S)-6-acetoxy-10-hydroxy-5a-methyl-1-oxo-3-(pyridin-3-yl)-1,5a,6,7,8,9,9a,10-octahydropyrano[4,3-b]chromen-8-yl)propane-1,2-diyl diacetate

ID: ALA5279156

Max Phase: Preclinical

Molecular Formula: C27H31NO10

Molecular Weight: 529.54

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)OC[C@](C)(OC(C)=O)[C@@H]1C[C@H](OC(C)=O)[C@@]2(C)Oc3cc(-c4cccnc4)oc(=O)c3[C@@H](O)[C@@H]2C1

Standard InChI:  InChI=1S/C27H31NO10/c1-14(29)34-13-26(4,37-16(3)31)18-9-19-24(32)23-21(38-27(19,5)22(10-18)35-15(2)30)11-20(36-25(23)33)17-7-6-8-28-12-17/h6-8,11-12,18-19,22,24,32H,9-10,13H2,1-5H3/t18-,19-,22-,24-,26-,27-/m0/s1

Standard InChI Key:  NIGGKHQHUNJNPM-JJDOQHQHSA-N

Molfile:  

 
     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
   -2.8584   -2.4745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1440   -2.8870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1440   -3.7120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4295   -2.4745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4295   -1.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4295   -0.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1440   -1.2370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8584   -1.6495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5729   -1.2370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5729   -0.4120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2874   -1.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7150   -1.2370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7150   -2.0620    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0003   -1.6497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7142   -1.2370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4288   -1.6495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1432   -1.2370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1432   -0.4120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8577   -1.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7142   -0.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7142    0.4132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4290    0.0008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4290    0.8261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1438    1.2387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1438    2.0639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8582    2.4764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5757    2.0621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2874    2.4786    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2874    3.2994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5711    3.7120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8582    3.3015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4290    2.4765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7143    2.0639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0001    2.4764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7143    1.2387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0003    0.8261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7148    1.2385    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0003    0.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0003   -0.8241    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7150   -0.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  2  0
  4  2  1  0
  5  4  1  0
  5  6  1  6
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 12  5  1  0
 12 13  1  6
 12 14  1  0
 14 15  1  0
 15 16  1  1
 16 17  1  0
 17 18  2  0
 17 19  1  0
 15 20  1  0
 20 21  1  1
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 26 25  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 26  2  0
 25 32  1  0
 32 33  1  0
 33 34  2  0
 35 33  1  0
 23 35  2  0
 35 36  1  0
 36 37  1  6
 38 36  1  0
 20 38  1  0
 38 39  1  6
 40 12  1  0
 40 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5279156

    ---

Associated Targets(Human)

SOAT2 Tchem Acyl coenzyme A:cholesterol acyltransferase 2 (288 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 529.54Molecular Weight (Monoisotopic): 529.1948AlogP: 2.73#Rotatable Bonds: 6
Polar Surface Area: 151.46Molecular Species: NEUTRALHBA: 11HBD: 1
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.86CX Basic pKa: 4.21CX LogP: 0.11CX LogD: 0.11
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.43Np Likeness Score: 1.24

References

1. Bhattacharjee P, Rutland N, Iyer MR..  (2022)  Targeting Sterol O-Acyltransferase/Acyl-CoA:Cholesterol Acyltransferase (ACAT): A Perspective on Small-Molecule Inhibitors and Their Therapeutic Potential.,  65  (24.0): [PMID:36473091] [10.1021/acs.jmedchem.2c01265]

Source