The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(Benzylsulfonyl)-1-(3-cyano-6-fluoro-5-oxo-5,6,7,8-tetrahydroquinolin-2-yl)piperidine-4-carboxamide ID: ALA5279194
Max Phase: Preclinical
Molecular Formula: C23H23FN4O4S
Molecular Weight: 470.53
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1cc2c(nc1N1CCC(C(=O)NS(=O)(=O)Cc3ccccc3)CC1)CCC(F)C2=O
Standard InChI: InChI=1S/C23H23FN4O4S/c24-19-6-7-20-18(21(19)29)12-17(13-25)22(26-20)28-10-8-16(9-11-28)23(30)27-33(31,32)14-15-4-2-1-3-5-15/h1-5,12,16,19H,6-11,14H2,(H,27,30)
Standard InChI Key: SKNMPUOULGHTOP-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
26.2038 -20.4504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.7993 -19.7447 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.3903 -20.4478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8505 -18.5174 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5601 -18.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5573 -17.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8487 -16.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2662 -18.5147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2655 -19.3328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9698 -19.7402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6793 -19.3340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6800 -18.5158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9712 -18.1039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2612 -16.8729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9674 -16.4616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3861 -19.7442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3843 -20.5613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0947 -19.3371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5101 -19.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2169 -19.7504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2104 -20.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9164 -20.9771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6259 -20.5700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6251 -19.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9186 -19.3422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1424 -18.1085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1466 -17.2889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4428 -16.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7303 -17.2818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7262 -18.1013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4345 -18.5170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4480 -16.0607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0253 -16.8687 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
26 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 27 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
5 8 1 0
14 15 3 0
6 14 1 0
11 16 1 0
16 17 2 0
16 18 1 0
18 2 1 0
2 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
26 27 2 0
26 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
28 32 2 0
29 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.53Molecular Weight (Monoisotopic): 470.1424AlogP: 2.28#Rotatable Bonds: 5Polar Surface Area: 120.23Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.98CX Basic pKa: 1.84CX LogP: 2.14CX LogD: 1.20Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.71Np Likeness Score: -1.34
References 1. Kong D, Xue T, Guo B, Cheng J, Liu S, Wei J, Lu Z, Liu H, Gong G, Lan T, Hu W, Hu W, Yang Y.. (2019) Optimization of P2Y12 Antagonist Ethyl 6-(4-((Benzylsulfonyl)carbamoyl)piperidin-1-yl)-5-cyano-2-methylnicotinate (AZD1283) Led to the Discovery of an Oral Antiplatelet Agent with Improved Druglike Properties., 62 (6.0): [PMID:30843696 ] [10.1021/acs.jmedchem.8b01971 ]