4,4'-((5-(4-(Aminomethyl)phenoxy)-1,3-phenylene)bis(oxy))dibenzimidamide

ID: ALA5279198

Max Phase: Preclinical

Molecular Formula: C27H25N5O3

Molecular Weight: 467.53

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N=C(N)c1ccc(Oc2cc(Oc3ccc(CN)cc3)cc(Oc3ccc(C(=N)N)cc3)c2)cc1

Standard InChI:  InChI=1S/C27H25N5O3/c28-16-17-1-7-20(8-2-17)33-23-13-24(34-21-9-3-18(4-10-21)26(29)30)15-25(14-23)35-22-11-5-19(6-12-22)27(31)32/h1-15H,16,28H2,(H3,29,30)(H3,31,32)

Standard InChI Key:  RXXCBUJREGMALF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -1.0700    2.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3554    2.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3564    2.0618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3564    1.2366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3536    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0700    1.2329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3536   -0.0003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3609   -0.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0757   -0.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7878   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7878   -1.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0776   -1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3609   -1.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5025   -1.6505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2171   -1.2380    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5025   -2.4758    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0710    2.4744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7857    2.0618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5004    2.4742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2126    2.0621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2126    1.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5023    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7857    1.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9272    0.8241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6418    1.2367    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7846    2.4739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4993    2.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4995    1.2361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2124    0.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9273    1.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9288    2.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2170    2.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6418    0.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6418    0.0004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9272   -0.0009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  5  7  1  0
  7  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
 11 14  1  0
 14 15  2  0
 14 16  1  0
  3 17  1  0
 17 18  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 18 23  1  0
 21 24  1  0
 24 25  1  0
  1 26  1  0
 26 27  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
 30 33  1  0
 33 34  1  0
 24 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5279198

    ---

Associated Targets(Human)

ST14 Tchem Matriptase (677 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 467.53Molecular Weight (Monoisotopic): 467.1957AlogP: 5.09#Rotatable Bonds: 9
Polar Surface Area: 153.45Molecular Species: BASEHBA: 6HBD: 5
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 8#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 11.97CX LogP: 3.44CX LogD: -3.22
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.17Np Likeness Score: -0.06

References

1. Hammerschmidt SJ, Maus H, Weldert AC, Gütschow M, Kersten C..  (2023)  Improving binding entropy by higher ligand symmetry? - A case study with human matriptase.,  14  (5): [PMID:37252099] [10.1039/d3md00125c]

Source