bis(2,2,2-trichloroethyl) (((2S,2aS,4aS,6S,6aS)-2,6-dimethylhexahydro-1,3,5-trioxa-2a1-azacyclopenta[cd]pentalene-2,6-diyl)bis(methylene))dicarbamate

ID: ALA5279206

Max Phase: Preclinical

Molecular Formula: C16H21Cl6N3O7

Molecular Weight: 580.08

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@]1(CNC(=O)OCC(Cl)(Cl)Cl)O[C@H]2CO[C@@H]3N2[C@H]1O[C@@]3(C)CNC(=O)OCC(Cl)(Cl)Cl

Standard InChI:  InChI=1S/C16H21Cl6N3O7/c1-13(4-23-11(26)29-6-15(17,18)19)9-25-8(3-28-9)31-14(2,10(25)32-13)5-24-12(27)30-7-16(20,21)22/h8-10H,3-7H2,1-2H3,(H,23,26)(H,24,27)/t8-,9-,10-,13-,14-/m0/s1

Standard InChI Key:  MRDYGPHQOIFTTP-DSDXBANLSA-N

Molfile:  

 
     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
    5.1838   -2.6807    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.6004   -2.0973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3869   -2.8942    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.6495    0.0151    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -4.3620    0.4276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3630   -0.3956    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.2036    0.6192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6995    1.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5629    0.8901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3504    0.6609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8129    1.3317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3129    1.9817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2411    1.9401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5379    1.7109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2046    2.8942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0004    2.8776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6213   -0.1057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5120    1.2359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1120    0.5567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9338   -0.0432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0171    2.3859    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5629    0.0776    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8161    2.5192    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4296   -0.2515    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9411    1.9317    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7046   -1.0223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1754   -1.6432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7578    1.9067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1911    2.5984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1463    1.1789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5160   -1.1713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7927   -1.9486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9708    1.1514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1838    0.3961    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.1389   -1.4693    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  6  5  1  0
  8  7  1  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 13  8  1  0
  9 14  1  0
 12 14  1  0
 13 14  1  0
 13 15  1  0
 12 16  1  0
 15 16  1  0
 10 17  1  1
  8 18  1  1
  8 19  1  0
 10 20  1  0
 12 21  1  1
  9 22  1  1
 13 23  1  1
 17 24  1  0
 18 25  1  0
 24 26  1  0
 26 27  2  0
 25 28  1  0
 28 29  2  0
 28 30  1  0
 26 31  1  0
 31 32  1  0
 32  2  1  0
 30 33  1  0
 33  5  1  0
  5 34  1  0
  2 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5279206

    ---

Associated Targets(Human)

HCRTR2 Tclin Orexin receptor 2 (5902 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 580.08Molecular Weight (Monoisotopic): 576.9511AlogP: 3.07#Rotatable Bonds: 6
Polar Surface Area: 107.59Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.00CX Basic pKa: CX LogP: 3.63CX LogD: 3.63
Aromatic Rings: Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: 0.21

References

1. Amezawa M, Yamamoto N, Nagumo Y, Kutsumura N, Ishikawa Y, Yanagisawa M, Nagase H, Saitoh T..  (2023)  Design and synthesis of novel orexin 2 receptor agonists with a 1,3,5‑trioxazatriquinane skeleton.,  82  [PMID:36690040] [10.1016/j.bmcl.2023.129151]

Source