The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5279319
Max Phase: Preclinical
Molecular Formula: C21H20FN5O2
Molecular Weight: 393.42
Associated Items:
Names and Identifiers Canonical SMILES: C=CC[C@H]1Nc2ccc3ncc(n3n2)C(=O)NC2(CC2)COc2ccc(F)cc21
Standard InChI: InChI=1S/C21H20FN5O2/c1-2-3-15-14-10-13(22)4-5-17(14)29-12-21(8-9-21)25-20(28)16-11-23-19-7-6-18(24-15)26-27(16)19/h2,4-7,10-11,15H,1,3,8-9,12H2,(H,24,26)(H,25,28)/t15-/m1/s1
Standard InChI Key: GWXTUUGNDSZLLS-OAHLLOKOSA-N
Molfile:
RDKit 2D
29 33 0 0 0 0 0 0 0 0999 V2000
-2.4331 2.9270 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.7171 2.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7171 1.6923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9978 1.2827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8723 0.4673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2820 -0.2486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8666 -0.9614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0416 -0.9614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3735 -1.6710 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0256 -2.3870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6716 -2.9326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4151 -2.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1676 -1.7018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6081 -0.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1929 -0.2389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6025 0.4771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1873 1.1899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3623 1.1899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2849 1.6980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2849 2.5229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0043 2.9326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4331 -0.9518 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8610 -2.3870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2763 -1.6775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0752 0.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3185 0.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3185 0.8889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1383 -0.5432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9354 -0.7568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 2 0
3 4 1 0
5 4 1 0
6 5 1 0
7 6 1 0
8 7 2 0
9 8 1 0
10 9 1 0
10 11 2 0
12 11 1 0
13 12 2 0
9 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
4 19 2 0
19 20 1 0
20 21 2 0
21 2 1 0
14 22 2 0
23 10 1 0
24 23 2 0
7 24 1 0
5 25 1 1
16 26 1 0
26 27 1 0
16 27 1 0
25 28 1 0
28 29 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 393.42Molecular Weight (Monoisotopic): 393.1601AlogP: 3.25#Rotatable Bonds: 2Polar Surface Area: 80.55Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.55CX LogP: 2.72CX LogD: 2.72Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.65Np Likeness Score: -0.45
References 1. Xiao X, Xu Y, Yu X, Chen Y, Zhao W, Xie Z, Zhu X, Xu H, Yang Y, Zhang P.. (2023) Discovery of imidazo[1,2-b]pyridazine macrocyclic derivatives as novel ALK inhibitors capable of combating multiple resistant mutants., 89 [PMID:37127101 ] [10.1016/j.bmcl.2023.129309 ]