The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-amino-3-(2-ethylphenyl)-4,5-dioxo-3,5-dihydro-4H-benzo[5,6]chromeno[3,4-c]pyridine-1-carbonitrile ID: ALA5279370
Max Phase: Preclinical
Molecular Formula: C25H17N3O3
Molecular Weight: 407.43
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccccc1-n1c(N)c(C#N)c2c(c(=O)oc3ccc4ccccc4c32)c1=O
Standard InChI: InChI=1S/C25H17N3O3/c1-2-14-7-4-6-10-18(14)28-23(27)17(13-26)21-20-16-9-5-3-8-15(16)11-12-19(20)31-25(30)22(21)24(28)29/h3-12H,2,27H2,1H3
Standard InChI Key: MKGNHEPYJJEUPF-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
1.0710 -2.6772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3565 -2.2647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3565 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0721 -1.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0721 -0.2044 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3547 0.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3600 -0.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3600 -1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0726 -1.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0726 -2.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3549 -2.6812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7826 -2.6790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4988 -2.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4988 -1.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7844 -1.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7844 -0.2020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5007 0.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2107 -0.2057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2107 -1.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0742 0.2037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7888 0.6162 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3547 1.0294 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7814 0.2081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4990 -0.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2107 0.2102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2107 1.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4944 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7814 1.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7866 -1.4416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0671 1.4459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1533 2.2664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
8 7 1 0
3 8 2 0
9 8 1 0
10 9 2 0
10 11 1 0
11 2 1 0
12 10 1 0
13 12 2 0
14 13 1 0
15 14 2 0
9 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
14 19 1 0
20 7 1 0
20 21 3 0
6 22 1 0
23 5 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 23 2 0
4 29 2 0
28 30 1 0
30 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.43Molecular Weight (Monoisotopic): 407.1270AlogP: 4.27#Rotatable Bonds: 2Polar Surface Area: 102.02Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.75CX LogD: 3.75Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.35Np Likeness Score: -0.61
References 1. Salehian F, Nadri H, Jalili-Baleh L, Youseftabar-Miri L, Abbas Bukhari SN, Foroumadi A, Tüylü Küçükkilinç T, Sharifzadeh M, Khoobi M.. (2021) A review: Biologically active 3,4-heterocycle-fused coumarins., 212 [PMID:33276991 ] [10.1016/j.ejmech.2020.113034 ]