The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3,4-dichloro-N-(2-(2-(3,4-dihydroxybenzamido)acetamido)-4,5,6,7-tetrahydrobenzo[d]thiazol-6-yl)-5-methyl-1H-pyrrole-2-carboxamide ID: ALA5279384
Max Phase: Preclinical
Molecular Formula: C22H21Cl2N5O5S
Molecular Weight: 538.41
Associated Items:
Names and Identifiers Canonical SMILES: Cc1[nH]c(C(=O)N[C@H]2CCc3nc(NC(=O)CNC(=O)c4ccc(O)c(O)c4)sc3C2)c(Cl)c1Cl
Standard InChI: InChI=1S/C22H21Cl2N5O5S/c1-9-17(23)18(24)19(26-9)21(34)27-11-3-4-12-15(7-11)35-22(28-12)29-16(32)8-25-20(33)10-2-5-13(30)14(31)6-10/h2,5-6,11,26,30-31H,3-4,7-8H2,1H3,(H,25,33)(H,27,34)(H,28,29,32)/t11-/m0/s1
Standard InChI Key: ADUXHLNCDZRIAM-NSHDSACASA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-5.2058 -0.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8733 0.4518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6184 1.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7934 1.2366 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.5383 0.4518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2058 -0.8582 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-6.6705 0.2383 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-6.0310 1.9512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7412 0.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1577 0.8218 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5277 -0.5586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3606 0.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7772 1.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9801 0.9782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7664 0.1811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3500 -0.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1470 -0.1887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0574 0.1379 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2880 1.4275 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.3531 0.9082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1502 1.1217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7337 0.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5308 0.7517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5201 -0.2587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1143 0.1683 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9114 0.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4949 -0.2015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1250 1.1789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2921 0.0117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8733 -0.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6597 -1.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8670 -1.5817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2805 -1.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6705 -0.3568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2432 -1.9512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 1 2 0
1 6 1 0
2 7 1 0
3 8 1 0
5 9 1 0
9 10 1 0
9 11 2 0
12 10 1 6
13 12 1 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 1 0
12 17 1 0
15 18 1 0
14 19 1 0
19 20 1 0
20 18 2 0
20 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
29 27 2 0
30 29 1 0
31 30 2 0
32 31 1 0
33 32 2 0
27 33 1 0
30 34 1 0
31 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.41Molecular Weight (Monoisotopic): 537.0640AlogP: 3.15#Rotatable Bonds: 6Polar Surface Area: 156.44Molecular Species: NEUTRALHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.71CX Basic pKa: ┄CX LogP: 2.74CX LogD: 2.57Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.26Np Likeness Score: -1.40