The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4,4-difluorocyclohexyl)-2-[(5-fluoro-4-oxo-3H-quinazolin-2-yl)sulfanyl]acetamide ID: ALA5279392
Max Phase: Preclinical
Molecular Formula: C16H16F3N3O2S
Molecular Weight: 371.38
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CSc1nc2cccc(F)c2c(=O)[nH]1)NC1CCC(F)(F)CC1
Standard InChI: InChI=1S/C16H16F3N3O2S/c17-10-2-1-3-11-13(10)14(24)22-15(21-11)25-8-12(23)20-9-4-6-16(18,19)7-5-9/h1-3,9H,4-8H2,(H,20,23)(H,21,22,24)
Standard InChI Key: LHVUYKSAYFRGBW-UHFFFAOYSA-N
Molfile:
RDKit 2D
25 27 0 0 0 0 0 0 0 0999 V2000
-4.3276 0.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6130 0.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9012 0.0141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9012 -0.8111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6112 -1.2229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3276 -0.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1865 0.4266 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4718 0.0140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4718 -0.8111 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1865 -1.2236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6112 -2.0480 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.1865 -2.0489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7572 0.4266 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.0426 0.0140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6720 0.4266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3866 0.0140 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6720 1.2518 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1013 0.4266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1012 1.2518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8159 1.6644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5305 1.2518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5305 0.4266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8159 0.0140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7440 2.0489 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.3276 1.4653 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 2 0
9 8 1 0
10 9 1 0
4 10 1 0
5 11 1 0
10 12 2 0
8 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
19 18 1 0
20 19 1 0
21 20 1 0
22 21 1 0
23 22 1 0
18 23 1 0
21 24 1 0
21 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 371.38Molecular Weight (Monoisotopic): 371.0915AlogP: 2.85#Rotatable Bonds: 4Polar Surface Area: 74.85Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.57CX Basic pKa: 2.70CX LogP: 2.16CX LogD: 2.14Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.64Np Likeness Score: -1.82
References 1. Urban M, Šlachtová V, Brulíková L.. (2021) Small organic molecules targeting the energy metabolism of Mycobacterium tuberculosis., 212 [PMID:33422979 ] [10.1016/j.ejmech.2020.113139 ]