The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5279393
Max Phase: Preclinical
Molecular Formula: C22H29NO6
Molecular Weight: 403.48
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H]1CC[C@H]2[C@@H](C)C(Nc3ccc(C(=O)O)cc3)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@]32OO4
Standard InChI: InChI=1S/C22H29NO6/c1-12-4-9-17-13(2)18(23-15-7-5-14(6-8-15)19(24)25)26-20-22(17)16(12)10-11-21(3,27-20)28-29-22/h5-8,12-13,16-18,20,23H,4,9-11H2,1-3H3,(H,24,25)/t12-,13-,16+,17+,18?,20-,21+,22-/m1/s1
Standard InChI Key: MLGSRHRPVQLWKY-GXXMZNBFSA-N
Molfile:
RDKit 2D
29 33 0 0 0 0 0 0 0 0999 V2000
1.0705 2.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7850 2.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4996 2.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4996 1.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7850 1.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0705 1.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3560 1.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3759 1.1160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7359 1.8549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3760 2.5889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4254 2.7810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5606 1.8549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1618 2.3040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1618 1.5159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3560 0.2048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0705 -0.2076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7850 0.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4993 -0.2075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7850 3.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0705 -1.0324 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3562 -1.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3559 -2.2696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3565 -2.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0710 -2.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0726 -1.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3610 -1.0307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7852 -2.6800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7852 -3.5048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4996 -2.2676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 1
6 5 1 0
1 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
11 10 1 0
1 11 1 1
9 12 1 1
9 13 1 0
13 14 1 0
6 14 1 6
7 15 1 6
15 16 1 0
5 17 1 0
16 17 1 0
17 18 1 1
2 19 1 6
16 20 1 0
20 21 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
21 26 1 0
24 27 1 0
27 28 2 0
27 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 403.48Molecular Weight (Monoisotopic): 403.1995AlogP: 4.00#Rotatable Bonds: 3Polar Surface Area: 86.25Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.69CX Basic pKa: 0.00CX LogP: 4.46CX LogD: 1.81Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.74Np Likeness Score: 2.18
References 1. Patel OPS, Beteck RM, Legoabe LJ.. (2021) Exploration of artemisinin derivatives and synthetic peroxides in antimalarial drug discovery research., 213 [PMID:33508479 ] [10.1016/j.ejmech.2021.113193 ]