The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[5-(4-fluorophenyl)-3-(4-hydroxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]benzene-1-sulfonamide ID: ALA5279498
Max Phase: Preclinical
Molecular Formula: C21H18FN3O3S
Molecular Weight: 411.46
Associated Items:
Names and Identifiers Canonical SMILES: NS(=O)(=O)c1ccc(N2N=C(c3ccc(O)cc3)CC2c2ccc(F)cc2)cc1
Standard InChI: InChI=1S/C21H18FN3O3S/c22-16-5-1-15(2-6-16)21-13-20(14-3-9-18(26)10-4-14)24-25(21)17-7-11-19(12-8-17)29(23,27)28/h1-12,21,26H,13H2,(H2,23,27,28)
Standard InChI Key: XVCROCRRDDBBKI-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
-0.7717 -0.2013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0532 -0.2013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3032 -1.0053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3501 -1.4760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0176 -0.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8142 -1.1975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0279 -1.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8223 -2.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4057 -1.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1948 -0.8298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3999 -0.6118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0999 -1.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3136 -2.0154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1080 -2.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6913 -1.6441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4805 -0.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6856 -0.6331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4880 -1.8575 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.7014 -2.6542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4880 -1.0328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2023 -1.4452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4655 0.5128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2903 0.5131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7007 1.2255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2883 1.9400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4677 1.9416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0514 1.2301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2023 -1.8363 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7007 2.6542 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
1 5 1 0
5 4 2 0
5 6 1 0
7 6 2 0
8 7 1 0
9 8 2 0
10 9 1 0
11 10 2 0
6 11 1 0
3 12 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
15 18 1 0
18 19 1 0
18 20 2 0
18 21 2 0
22 2 1 0
23 22 2 0
24 23 1 0
25 24 2 0
26 25 1 0
22 27 1 0
27 26 2 0
9 28 1 0
25 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 411.46Molecular Weight (Monoisotopic): 411.1053AlogP: 3.53#Rotatable Bonds: 4Polar Surface Area: 95.99Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.06CX Basic pKa: 3.71CX LogP: 3.86CX LogD: 3.85Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.69Np Likeness Score: -1.42
References 1. Nehra B, Rulhania S, Jaswal S, Kumar B, Singh G, Monga V.. (2020) Recent advancements in the development of bioactive pyrazoline derivatives., 205 [PMID:32795767 ] [10.1016/j.ejmech.2020.112666 ]