The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-((4-((2,6-difluorophenyl)amino)-5-fluoropyrimidin-2-yl)amino)-2-fluorophenyl)-2-(dimethylamino)acetamide ID: ALA5279564
Max Phase: Preclinical
Molecular Formula: C20H18F4N6O
Molecular Weight: 434.40
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CC(=O)Nc1cc(Nc2ncc(F)c(Nc3c(F)cccc3F)n2)ccc1F
Standard InChI: InChI=1S/C20H18F4N6O/c1-30(2)10-17(31)27-16-8-11(6-7-12(16)21)26-20-25-9-15(24)19(29-20)28-18-13(22)4-3-5-14(18)23/h3-9H,10H2,1-2H3,(H,27,31)(H2,25,26,28,29)
Standard InChI Key: VMZGYYCCAWUCHJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
-1.7773 2.0534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7773 1.2284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0639 0.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3568 1.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3568 2.0538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0657 2.4640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3547 2.4647 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0663 2.0538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7781 2.4644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4871 2.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4871 1.2322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7799 0.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0663 1.2285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7799 0.0004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0680 -0.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0680 -1.2322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3581 -1.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3551 -1.2301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3551 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3536 0.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3536 0.8238 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.7796 -1.6430 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.1988 0.8214 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.0639 0.0004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7756 -0.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7756 -1.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4871 -1.6430 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4871 -2.4647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1988 -1.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4871 0.0004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4889 0.8176 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
5 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
12 14 1 0
14 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
15 20 1 0
20 21 1 0
16 22 1 0
11 23 1 0
3 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
25 30 2 0
2 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.40Molecular Weight (Monoisotopic): 434.1478AlogP: 4.02#Rotatable Bonds: 7Polar Surface Area: 82.18Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.58CX Basic pKa: 7.05CX LogP: 3.90CX LogD: 3.74Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.49Np Likeness Score: -1.84
References 1. Marak BN, Dowarah J, Khiangte L, Singh VP.. (2020) A comprehensive insight on the recent development of Cyclic Dependent Kinase inhibitors as anticancer agents., 203 [PMID:32707525 ] [10.1016/j.ejmech.2020.112571 ]