N-(4-bromophenyl)-2-(5-(3-methoxybenzyl)-3-methyl-6-oxo-4-phenylpyridazin-1(6H)-yl)acetamide

ID: ALA5279627

Max Phase: Preclinical

Molecular Formula: C27H24BrN3O3

Molecular Weight: 518.41

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(Cc2c(-c3ccccc3)c(C)nn(CC(=O)Nc3ccc(Br)cc3)c2=O)c1

Standard InChI:  InChI=1S/C27H24BrN3O3/c1-18-26(20-8-4-3-5-9-20)24(16-19-7-6-10-23(15-19)34-2)27(33)31(30-18)17-25(32)29-22-13-11-21(28)12-14-22/h3-15H,16-17H2,1-2H3,(H,29,32)

Standard InChI Key:  OYJTYRBFYHVJQJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   -4.6428    2.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9284    2.6793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2138    2.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4991    2.6795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7826    2.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7826    1.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5002    1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2138    1.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5002    0.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7857   -0.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7857   -1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5002   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5002   -2.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2131   -2.6795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9294   -2.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9294   -1.4459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2177   -1.0294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0709   -1.4439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0709   -2.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3562   -1.0313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3562   -0.2059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3582    0.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0727   -0.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0727   -1.0310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7872    0.2065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5017   -0.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5017   -1.0345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2182   -1.4426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9284   -1.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6428   -1.4433    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    3.9284   -0.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2164    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0709    0.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0709    1.0317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  7  6  1  0
  3  8  1  0
  8  7  2  0
  9  7  1  0
 10  9  1  0
 10 11  2  0
 11 12  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 12 17  1  0
 11 18  1  0
 18 19  1  0
 18 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 31 32  1  0
 32 26  2  0
 21 33  1  0
 10 33  1  0
 33 34  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5279627

    ---

Associated Targets(Human)

FPR2 Tchem Lipoxin A4 receptor (3472 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FPR1 Tchem Formyl peptide receptor 1 (1372 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 518.41Molecular Weight (Monoisotopic): 517.1001AlogP: 5.22#Rotatable Bonds: 7
Polar Surface Area: 73.22Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.69CX Basic pKa: CX LogP: 5.09CX LogD: 5.09
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.36Np Likeness Score: -1.35

References

1. Maciuszek M, Cacace A, Brennan E, Godson C, Chapman TM..  (2021)  Recent advances in the design and development of formyl peptide receptor 2 (FPR2/ALX) agonists as pro-resolving agents with diverse therapeutic potential.,  213  [PMID:33486199] [10.1016/j.ejmech.2021.113167]

Source