The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-bromophenyl)-2-(5-(3-methoxybenzyl)-3-methyl-6-oxo-4-phenylpyridazin-1(6H)-yl)acetamide ID: ALA5279627
Max Phase: Preclinical
Molecular Formula: C27H24BrN3O3
Molecular Weight: 518.41
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(Cc2c(-c3ccccc3)c(C)nn(CC(=O)Nc3ccc(Br)cc3)c2=O)c1
Standard InChI: InChI=1S/C27H24BrN3O3/c1-18-26(20-8-4-3-5-9-20)24(16-19-7-6-10-23(15-19)34-2)27(33)31(30-18)17-25(32)29-22-13-11-21(28)12-14-22/h3-15H,16-17H2,1-2H3,(H,29,32)
Standard InChI Key: OYJTYRBFYHVJQJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-4.6428 2.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9284 2.6793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2138 2.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4991 2.6795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7826 2.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7826 1.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5002 1.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2138 1.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5002 0.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7857 -0.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7857 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5002 -1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5002 -2.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2131 -2.6795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9294 -2.2668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9294 -1.4459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2177 -1.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0709 -1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0709 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3562 -1.0313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3562 -0.2059 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3582 0.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0727 -0.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0727 -1.0310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7872 0.2065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5017 -0.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5017 -1.0345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2182 -1.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9284 -1.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6428 -1.4433 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
3.9284 -0.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2164 0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0709 0.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0709 1.0317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
7 6 1 0
3 8 1 0
8 7 2 0
9 7 1 0
10 9 1 0
10 11 2 0
11 12 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
11 18 1 0
18 19 1 0
18 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
29 31 2 0
31 32 1 0
32 26 2 0
21 33 1 0
10 33 1 0
33 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.41Molecular Weight (Monoisotopic): 517.1001AlogP: 5.22#Rotatable Bonds: 7Polar Surface Area: 73.22Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.69CX Basic pKa: ┄CX LogP: 5.09CX LogD: 5.09Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.36Np Likeness Score: -1.35
References 1. Maciuszek M, Cacace A, Brennan E, Godson C, Chapman TM.. (2021) Recent advances in the design and development of formyl peptide receptor 2 (FPR2/ALX) agonists as pro-resolving agents with diverse therapeutic potential., 213 [PMID:33486199 ] [10.1016/j.ejmech.2021.113167 ]