The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1-carboxy-2-(1-(3,5-dichlorobenzyl)-1H-imidazol-5-yl)ethyl)leucine ID: ALA5279656
Max Phase: Preclinical
Molecular Formula: C19H23Cl2N3O4
Molecular Weight: 428.32
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CC(NC(Cc1cncn1Cc1cc(Cl)cc(Cl)c1)C(=O)O)C(=O)O
Standard InChI: InChI=1S/C19H23Cl2N3O4/c1-11(2)3-16(18(25)26)23-17(19(27)28)7-15-8-22-10-24(15)9-12-4-13(20)6-14(21)5-12/h4-6,8,10-11,16-17,23H,3,7,9H2,1-2H3,(H,25,26)(H,27,28)
Standard InChI Key: NTCCRGGIJNDEAB-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 29 0 0 0 0 0 0 0 0999 V2000
-3.0732 -1.3188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0732 -2.1438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3598 -2.5502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6528 -2.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6528 -1.3184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3616 -0.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9411 -0.9075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9411 -0.0859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6527 0.3249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4680 1.1429 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6700 1.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3392 0.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4544 0.2541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0354 0.8351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8291 0.6225 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4101 1.2035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2038 0.9908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7848 1.5718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4165 0.1971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1974 1.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7784 2.5782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5657 3.3719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5721 2.3655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8227 1.6288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0290 1.8415 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4037 2.2099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3598 -3.3719 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.7848 -0.9080 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
5 7 1 0
7 8 1 0
9 8 1 0
9 10 2 0
10 11 1 0
12 11 2 0
8 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
16 20 1 0
20 21 1 0
21 22 1 0
21 23 1 0
14 24 1 0
24 25 2 0
24 26 1 0
3 27 1 0
1 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.32Molecular Weight (Monoisotopic): 427.1066AlogP: 3.32#Rotatable Bonds: 10Polar Surface Area: 104.45Molecular Species: ACIDHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.64CX Basic pKa: 8.30CX LogP: -0.90CX LogD: -2.11Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.54Np Likeness Score: -0.60
References 1. Xiu S, Dick A, Ju H, Mirzaie S, Abdi F, Cocklin S, Zhan P, Liu X.. (2020) Inhibitors of SARS-CoV-2 Entry: Current and Future Opportunities., 63 (21.0): [PMID:32539378 ] [10.1021/acs.jmedchem.0c00502 ]