The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3R,4S,5R,6S)-2-(acetoxymethyl)-6-((2-oxo-4-phenyl-2H-chromen-7-yl)oxy)tetrahydro-2H-pyran-3,4,5-triyl triacetate ID: ALA5279727
Max Phase: Preclinical
Molecular Formula: C29H28O12
Molecular Weight: 568.53
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)OC[C@H]1O[C@@H](Oc2ccc3c(-c4ccccc4)cc(=O)oc3c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O
Standard InChI: InChI=1S/C29H28O12/c1-15(30)35-14-24-26(36-16(2)31)27(37-17(3)32)28(38-18(4)33)29(41-24)39-20-10-11-21-22(19-8-6-5-7-9-19)13-25(34)40-23(21)12-20/h5-13,24,26-29H,14H2,1-4H3/t24-,26-,27+,28-,29-/m1/s1
Standard InChI Key: QCLMGHOOPBXDPV-KRZJEZTLSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
-2.1411 0.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4267 1.0307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7122 0.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7122 -0.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4267 -0.6192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1411 -0.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8554 -0.6191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4267 -1.4440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0020 -0.6191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0020 1.0306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7162 0.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4307 1.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1424 0.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1424 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4324 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7162 -0.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8554 1.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8554 1.8553 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5697 2.2677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5697 3.0925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2839 1.8553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5697 -0.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2839 -0.6191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5697 0.6180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1409 -1.8564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1409 -2.6811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8552 -1.4440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0020 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7162 -1.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7122 -1.8562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8549 1.0294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5697 0.6170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5715 -0.2037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8600 -0.6203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8600 -1.4451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5741 -1.8577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5734 -2.6800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8589 -3.0925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1474 -2.6835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1427 -1.8592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2839 1.0294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
1 6 1 0
6 7 1 6
5 8 1 1
4 9 1 6
3 10 1 1
10 11 1 0
12 11 2 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 2 0
11 16 1 0
1 17 1 1
17 18 1 0
18 19 1 0
19 20 2 0
19 21 1 0
7 22 1 0
22 23 1 0
22 24 2 0
8 25 1 0
25 26 1 0
25 27 2 0
9 28 1 0
28 29 1 0
28 30 2 0
13 31 1 0
32 31 1 0
33 32 1 0
34 33 2 0
14 34 1 0
35 34 1 0
36 35 2 0
37 36 1 0
38 37 2 0
39 38 1 0
35 40 1 0
40 39 2 0
32 41 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 568.53Molecular Weight (Monoisotopic): 568.1581AlogP: 2.92#Rotatable Bonds: 8Polar Surface Area: 153.87Molecular Species: NEUTRALHBA: 12HBD: ┄#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.41CX LogD: 2.41Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.22Np Likeness Score: 0.96
References 1. Gonçalves GA, Spillere AR, das Neves GM, Kagami LP, von Poser GL, Canto RFS, Eifler-Lima V.. (2020) Natural and synthetic coumarins as antileishmanial agents: A review., 203 [PMID:32668302 ] [10.1016/j.ejmech.2020.112514 ]