5-(((4-(4-methoxyphenyl)-5-(pyridin-4-yl)-4H-1,2,4-triazol-3-yl)methyl)thio)-3-(p-tolyl)-1,2,4-oxadiazole

ID: ALA5279880

Max Phase: Preclinical

Molecular Formula: C24H20N6O2S

Molecular Weight: 456.53

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-n2c(CSc3nc(-c4ccc(C)cc4)no3)nnc2-c2ccncc2)cc1

Standard InChI:  InChI=1S/C24H20N6O2S/c1-16-3-5-17(6-4-16)22-26-24(32-29-22)33-15-21-27-28-23(18-11-13-25-14-12-18)30(21)19-7-9-20(31-2)10-8-19/h3-14H,15H2,1-2H3

Standard InChI Key:  NMOZHHGBLJZLFQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   -4.1610   -0.3762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1610   -1.2012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4476   -1.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7406   -1.1976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7406   -0.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4494    0.0342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0289   -1.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8512   -2.4060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0305   -2.4979    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7012   -1.7665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3174   -1.1976    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3174   -0.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6027    0.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6027    0.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3163    1.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0281    0.8543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0281    0.0351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3163    2.0870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6047    2.4979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0924   -1.5538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6734   -2.1348    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.4671   -1.9221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6798   -1.0951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5177   -1.0951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8021   -1.8451    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1568   -2.3604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9286   -0.3835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7538   -0.3835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1603    0.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7501    1.0373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9282    1.0373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5179    0.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1610    1.7489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  7  4  1  0
  7  8  2  0
  8  9  1  0
 10  9  2  0
 11 10  1  0
  7 11  1  0
 12 11  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 12  2  0
 15 18  1  0
 18 19  1  0
 10 20  1  0
 20 21  1  0
 21 22  1  0
 23 22  2  0
 23 24  1  0
 24 25  2  0
 26 25  1  0
 22 26  1  0
 27 24  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 27  2  0
 30 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5279880

    ---

Associated Targets(Human)

SW480 (6023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.53Molecular Weight (Monoisotopic): 456.1368AlogP: 4.99#Rotatable Bonds: 7
Polar Surface Area: 91.75Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.62CX LogP: 4.81CX LogD: 4.81
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.32Np Likeness Score: -1.90

References

1. Phull MS, Jadav SS, Gundla R, Mainkar PS..  (2021)  A perspective on medicinal chemistry approaches towards adenomatous polyposis coli and Wnt signal based colorectal cancer inhibitors.,  212  [PMID:33445154] [10.1016/j.ejmech.2020.113149]

Source