The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(((4-(4-methoxyphenyl)-5-(pyridin-4-yl)-4H-1,2,4-triazol-3-yl)methyl)thio)-3-(p-tolyl)-1,2,4-oxadiazole ID: ALA5279880
Max Phase: Preclinical
Molecular Formula: C24H20N6O2S
Molecular Weight: 456.53
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-n2c(CSc3nc(-c4ccc(C)cc4)no3)nnc2-c2ccncc2)cc1
Standard InChI: InChI=1S/C24H20N6O2S/c1-16-3-5-17(6-4-16)22-26-24(32-29-22)33-15-21-27-28-23(18-11-13-25-14-12-18)30(21)19-7-9-20(31-2)10-8-19/h3-14H,15H2,1-2H3
Standard InChI Key: NMOZHHGBLJZLFQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-4.1610 -0.3762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.1610 -1.2012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4476 -1.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7406 -1.1976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7406 -0.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4494 0.0342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0289 -1.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8512 -2.4060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0305 -2.4979 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7012 -1.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3174 -1.1976 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3174 -0.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6027 0.0366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6027 0.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3163 1.2653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0281 0.8543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0281 0.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3163 2.0870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6047 2.4979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0924 -1.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6734 -2.1348 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.4671 -1.9221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6798 -1.0951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5177 -1.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8021 -1.8451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1568 -2.3604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9286 -0.3835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7538 -0.3835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1603 0.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7501 1.0373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9282 1.0373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5179 0.3282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1610 1.7489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
7 4 1 0
7 8 2 0
8 9 1 0
10 9 2 0
11 10 1 0
7 11 1 0
12 11 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 12 2 0
15 18 1 0
18 19 1 0
10 20 1 0
20 21 1 0
21 22 1 0
23 22 2 0
23 24 1 0
24 25 2 0
26 25 1 0
22 26 1 0
27 24 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 27 2 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.53Molecular Weight (Monoisotopic): 456.1368AlogP: 4.99#Rotatable Bonds: 7Polar Surface Area: 91.75Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.62CX LogP: 4.81CX LogD: 4.81Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.32Np Likeness Score: -1.90
References 1. Phull MS, Jadav SS, Gundla R, Mainkar PS.. (2021) A perspective on medicinal chemistry approaches towards adenomatous polyposis coli and Wnt signal based colorectal cancer inhibitors., 212 [PMID:33445154 ] [10.1016/j.ejmech.2020.113149 ]