N-(4-methoxyphenyl)-4-(4-methyl-3-(methylsulfonyl)phenyl)phthalazin-1-amine

ID: ALA5279934

Max Phase: Preclinical

Molecular Formula: C23H21N3O3S

Molecular Weight: 419.51

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(Nc2nnc(-c3ccc(C)c(S(C)(=O)=O)c3)c3ccccc23)cc1

Standard InChI:  InChI=1S/C23H21N3O3S/c1-15-8-9-16(14-21(15)30(3,27)28)22-19-6-4-5-7-20(19)23(26-25-22)24-17-10-12-18(29-2)13-11-17/h4-14H,1-3H3,(H,24,26)

Standard InChI Key:  CNNXUIUUDGEHSH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    2.1428   -3.7105    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4283   -3.2981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4283   -2.4728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7164   -2.0609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0018   -2.4732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7126   -2.0607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7126   -1.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0020   -0.8231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0028   -0.0006    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7115    0.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7115    1.2371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0016    1.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0016    2.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7134    2.8855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7134    3.7105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4278    2.4733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4278    1.6450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4290   -0.0021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1486    0.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8573   -0.0129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8507   -0.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1340   -1.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4243   -0.8266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0018   -3.3018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7182   -3.7098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7127    2.8862    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.4272    2.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8573   -3.2981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1260    3.6020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3002    3.6020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  6  5  1  0
  7  6  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 17 11  2  0
 16 17  1  0
 10 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 23 22  1  0
 23  7  1  0
 18 23  2  0
  5 24  1  0
 25  2  1  0
 24 25  2  0
 13 26  1  0
 26 27  1  0
  1 28  1  0
 26 29  2  0
 26 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5279934

    ---

Associated Targets(non-human)

Slc14a1 Urea transporter 1 (62 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.51Molecular Weight (Monoisotopic): 419.1304AlogP: 4.76#Rotatable Bonds: 5
Polar Surface Area: 81.18Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.33CX LogP: 4.03CX LogD: 4.03
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.50Np Likeness Score: -1.40

References

1. Titko T, Perekhoda L, Drapak I, Tsapko Y..  (2020)  Modern trends in diuretics development.,  208  [PMID:33007663] [10.1016/j.ejmech.2020.112855]

Source