The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-methoxyphenyl)-4-(4-methyl-3-(methylsulfonyl)phenyl)phthalazin-1-amine ID: ALA5279934
Max Phase: Preclinical
Molecular Formula: C23H21N3O3S
Molecular Weight: 419.51
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Nc2nnc(-c3ccc(C)c(S(C)(=O)=O)c3)c3ccccc23)cc1
Standard InChI: InChI=1S/C23H21N3O3S/c1-15-8-9-16(14-21(15)30(3,27)28)22-19-6-4-5-7-20(19)23(26-25-22)24-17-10-12-18(29-2)13-11-17/h4-14H,1-3H3,(H,24,26)
Standard InChI Key: CNNXUIUUDGEHSH-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
2.1428 -3.7105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4283 -3.2981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4283 -2.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7164 -2.0609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0018 -2.4732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7126 -2.0607 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7126 -1.2357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0020 -0.8231 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0028 -0.0006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7115 0.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7115 1.2371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0016 1.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0016 2.4737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7134 2.8855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7134 3.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4278 2.4733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4278 1.6450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4290 -0.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1486 0.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8573 -0.0129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8507 -0.8332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1340 -1.2413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4243 -0.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0018 -3.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7182 -3.7098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7127 2.8862 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.4272 2.4737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8573 -3.2981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1260 3.6020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3002 3.6020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 2 0
3 4 1 0
4 5 2 0
6 5 1 0
7 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
14 16 2 0
17 11 2 0
16 17 1 0
10 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
23 22 1 0
23 7 1 0
18 23 2 0
5 24 1 0
25 2 1 0
24 25 2 0
13 26 1 0
26 27 1 0
1 28 1 0
26 29 2 0
26 30 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.51Molecular Weight (Monoisotopic): 419.1304AlogP: 4.76#Rotatable Bonds: 5Polar Surface Area: 81.18Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.33CX LogP: 4.03CX LogD: 4.03Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.50Np Likeness Score: -1.40