ethyl 3'-(2-hydroxyphenyl)-2-oxo-1'-(piperidine-1-carbonyl)spiro[indoline-3,2'-pyrrolidine]-4'-carboxylate

ID: ALA5279985

Max Phase: Preclinical

Molecular Formula: C26H29N3O5

Molecular Weight: 463.53

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1CN(C(=O)N2CCCCC2)C2(C(=O)Nc3ccccc32)C1c1ccccc1O

Standard InChI:  InChI=1S/C26H29N3O5/c1-2-34-23(31)18-16-29(25(33)28-14-8-3-9-15-28)26(22(18)17-10-4-7-13-21(17)30)19-11-5-6-12-20(19)27-24(26)32/h4-7,10-13,18,22,30H,2-3,8-9,14-16H2,1H3,(H,27,32)

Standard InChI Key:  SCJWAXGWKWKTPE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   -1.6754    1.2923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8890    0.4954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6859    0.2819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2692    0.8652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0556    1.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2588    1.8756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3056   -0.0879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5191   -0.8847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5088    0.1256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1451   -0.3563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4467   -0.8999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2572   -0.8093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7347   -1.4655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4094   -2.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6022   -2.2954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1214   -1.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6632   -1.5647    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8449   -0.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5593   -0.3479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7853    0.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5901   -0.0768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8364   -0.8678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2530   -1.4511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6416   -1.0444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1972   -0.4402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9519    0.3476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1498    0.5291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5403    0.8925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0999    1.4985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9047    1.3169    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4644    1.9230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2692    1.7413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8864    2.2954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2679    0.8925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  6  5  1  0
  1  6  1  0
  7  2  1  0
  7  8  2  0
  9  7  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 16 15  1  0
 11 16  2  0
 17 16  1  0
 18 17  1  0
 10 18  1  0
 18 19  2  0
 20 10  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 24 25  1  0
 25 26  2  0
 27 26  1  0
 21 27  2  0
 28 20  1  0
 28 29  1  0
 30 29  1  0
 30 31  1  0
 31 32  1  0
 29 33  2  0
 34 28  1  0
 34  9  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5279985

    ---

Associated Targets(Human)

TP53 Tchem Tumour suppressor p53/oncoprotein Mdm2 (2075 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.53Molecular Weight (Monoisotopic): 463.2107AlogP: 3.42#Rotatable Bonds: 3
Polar Surface Area: 99.18Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.31CX Basic pKa: CX LogP: 2.82CX LogD: 2.81
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.68Np Likeness Score: -0.10

References

1. Bora D, Kaushal A, Shankaraiah N..  (2021)  Anticancer potential of spirocompounds in medicinal chemistry: A pentennial expedition.,  215  [PMID:33601313] [10.1016/j.ejmech.2021.113263]

Source