6-methoxy-2-((1-(methylsulfonyl)piperidin-4-yl)amino)-8-(tetrahydro-2H-pyran-4-yl)pteridin-7(8H)-one

ID: ALA5280030

Max Phase: Preclinical

Molecular Formula: C18H26N6O5S

Molecular Weight: 438.51

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1nc2cnc(NC3CCN(S(C)(=O)=O)CC3)nc2n(C2CCOCC2)c1=O

Standard InChI:  InChI=1S/C18H26N6O5S/c1-28-16-17(25)24(13-5-9-29-10-6-13)15-14(21-16)11-19-18(22-15)20-12-3-7-23(8-4-12)30(2,26)27/h11-13H,3-10H2,1-2H3,(H,19,20,22)

Standard InChI Key:  OJGQCEPTZFWPMK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    0.3587    1.2373    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0733    1.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7851    1.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7851    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0751    0.0007    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3587    0.4088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4998    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144    1.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4998    1.6503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9290   -0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4998   -0.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3559   -0.0037    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0705    0.4088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7851   -0.0037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4997    0.4088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4997    1.2340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7851    1.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0705    1.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2144    1.6466    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9290    1.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8010    2.3626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6270    2.3626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9290    1.6503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9290    2.4755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144   -1.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144   -2.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4998   -2.4755    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7851   -2.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7851   -1.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  3 10  1  0
  8 11  2  0
 12  7  1  0
  6 13  1  0
 13 14  1  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
 14 19  1  0
 17 20  1  0
 20 21  1  0
 20 22  2  0
 20 23  2  0
  9 24  1  0
 24 25  1  0
 26 12  1  0
 27 26  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 12 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5280030

    ---

Associated Targets(Human)

CCNE1 Tchem Cyclin-dependent kinase 2/cyclin E (1410 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.51Molecular Weight (Monoisotopic): 438.1685AlogP: 0.38#Rotatable Bonds: 5
Polar Surface Area: 128.54Molecular Species: NEUTRALHBA: 10HBD: 1
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.43CX LogP: -1.36CX LogD: -1.36
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.70Np Likeness Score: -1.43

References

1. Wang X, Ding L, Jiang H, Yuan X, Xiang L, Tang C..  (2023)  Synthesis and biological evaluation of novel pteridin-7(8H)-one derivatives as potent CDK2 inhibitors.,  88  [PMID:37060933] [10.1016/j.bmcl.2023.129284]

Source