(cis)-8-hydroxy-8-propyl-2-(4-(trifluoromethoxy)phenyl)-2-azaspiro[4.5]decan-1-one

ID: ALA5280062

Max Phase: Preclinical

Molecular Formula: C19H24F3NO3

Molecular Weight: 371.40

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC[C@]1(O)CC[C@]2(CCN(c3ccc(OC(F)(F)F)cc3)C2=O)CC1

Standard InChI:  InChI=1S/C19H24F3NO3/c1-2-7-18(25)10-8-17(9-11-18)12-13-23(16(17)24)14-3-5-15(6-4-14)26-19(20,21)22/h3-6,25H,2,7-13H2,1H3/t17-,18+

Standard InChI Key:  YJVSFAZOEDSXEX-HDICACEKSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    3.3150   -3.7430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0399   -3.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3364   -2.9183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7279   -4.0422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6929   -3.4044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2596   -4.0023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0032   -3.6481    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8963   -2.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0864   -2.6809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2970   -2.6705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4759   -2.6475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4341   -4.0758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2615   -4.1006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1086   -4.8133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7446   -4.8651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4685   -5.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1731   -4.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1494   -3.9995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4250   -3.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8985   -5.2217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9206   -6.0463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6458   -6.4395    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.2175   -6.4778    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.8927   -6.8694    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.3578   -2.0936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6543   -1.6627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6
  3  2  1  0
  5  6  1  6
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  5 10  1  0
  5 13  1  0
 10 11  1  0
 11  2  1  0
  2 12  1  0
 12 13  1  0
  7  4  1  0
  6 14  2  0
  4 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19  4  1  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 21 24  1  0
  3 25  1  0
 25 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5280062

    ---

Associated Targets(Human)

LIPE Tchem Hormone sensitive lipase (506 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 371.40Molecular Weight (Monoisotopic): 371.1708AlogP: 4.41#Rotatable Bonds: 4
Polar Surface Area: 49.77Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.56CX LogD: 4.56
Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.85Np Likeness Score: -0.13

References

1. Kuhn B, Guba W, Hert J, Banner D, Bissantz C, Ceccarelli S, Haap W, Körner M, Kuglstatter A, Lerner C, Mattei P, Neidhart W, Pinard E, Rudolph MG, Schulz-Gasch T, Woltering T, Stahl M..  (2016)  A Real-World Perspective on Molecular Design.,  59  (9): [PMID:26878596] [10.1021/acs.jmedchem.5b01875]

Source