The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-cyclopropyl-6-fluoro-8-methoxy-7-(piperidin-1-yl)-3-(thiazolidine-3-carbonyl)quinolin-4(1H)-one ID: ALA5280084
Max Phase: Preclinical
Molecular Formula: C22H26FN3O3S
Molecular Weight: 431.53
Associated Items:
Names and Identifiers Canonical SMILES: COc1c(N2CCCCC2)c(F)cc2c(=O)c(C(=O)N3CCSC3)cn(C3CC3)c12
Standard InChI: InChI=1S/C22H26FN3O3S/c1-29-21-18-15(11-17(23)19(21)24-7-3-2-4-8-24)20(27)16(12-26(18)14-5-6-14)22(28)25-9-10-30-13-25/h11-12,14H,2-10,13H2,1H3
Standard InChI Key: MBMHZNAUIHOFSP-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
-2.4373 1.1824 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.7228 0.7699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7228 -0.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4373 -0.4707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1517 -0.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8662 -0.4707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8662 -1.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1517 -1.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4373 -1.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0066 -0.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0066 -1.2912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2921 -1.7037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2967 -0.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4177 -0.4670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4177 -1.2921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8294 -2.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0045 -2.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1322 -0.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1322 0.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8467 1.1828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5611 0.7703 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6473 -0.0496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4539 -0.2211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8662 0.4929 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.3144 1.1057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8467 2.0078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4177 1.1828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4177 2.0078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2967 0.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0084 1.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
4 3 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
4 9 1 0
3 10 2 0
10 11 1 0
11 12 1 0
10 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
17 16 1 0
17 15 1 0
14 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
22 21 1 0
23 22 1 0
24 23 1 0
25 24 1 0
25 21 1 0
20 26 2 0
19 27 1 0
27 28 2 0
29 27 1 0
13 29 2 0
29 30 1 0
30 2 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.53Molecular Weight (Monoisotopic): 431.1679AlogP: 3.62#Rotatable Bonds: 4Polar Surface Area: 54.78Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.69CX LogD: 2.69Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.74Np Likeness Score: -1.00