2,3,4,5,6-pentafluoro-N-(4-hydroxy-3-(phenylthio)naphthalen-1-yl)benzenesulfonamide

ID: ALA5280147

Max Phase: Preclinical

Molecular Formula: C22H12F5NO3S2

Molecular Weight: 497.47

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=S(=O)(Nc1cc(Sc2ccccc2)c(O)c2ccccc12)c1c(F)c(F)c(F)c(F)c1F

Standard InChI:  InChI=1S/C22H12F5NO3S2/c23-16-17(24)19(26)22(20(27)18(16)25)33(30,31)28-14-10-15(32-11-6-2-1-3-7-11)21(29)13-9-5-4-8-12(13)14/h1-10,28-29H

Standard InChI Key:  ZXJHEANDHXHGMV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -2.8537    2.2694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1391    2.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4272    2.2698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4272    1.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1373    1.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8537    1.4409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7146    2.6806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0003    2.2682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0003    1.4471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7095    1.0304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7149    2.6808    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.4296    2.2682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1444    2.6806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8565    2.2686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8565    1.4432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1461    1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4296    1.4395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7146    3.5058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7095    0.2053    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4241   -0.2073    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4241   -1.0324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7103   -1.4453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7103   -2.2680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4252   -2.6807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1418   -2.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1418   -1.4468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8565   -1.0342    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8516   -2.6841    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4252   -3.5058    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0042   -2.6805    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0050   -1.0326    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8375    0.5086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2501   -0.2073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  3  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  4 10  1  0
  8 11  1  0
 11 12  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 12 17  1  0
  7 18  1  0
 10 19  1  0
 19 20  1  0
 20 21  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 21 26  1  0
 26 27  1  0
 25 28  1  0
 24 29  1  0
 23 30  1  0
 22 31  1  0
 20 32  2  0
 20 33  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5280147

    ---

Associated Targets(Human)

STAT3 Tchem Signal transducer and activator of transcription 3 (3313 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 497.47Molecular Weight (Monoisotopic): 497.0179AlogP: 6.19#Rotatable Bonds: 5
Polar Surface Area: 66.40Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.73CX Basic pKa: CX LogP: 6.05CX LogD: 5.06
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.15Np Likeness Score: -0.97

References

1. Dong J, Cheng XD, Zhang WD, Qin JJ..  (2021)  Recent Update on Development of Small-Molecule STAT3 Inhibitors for Cancer Therapy: From Phosphorylation Inhibition to Protein Degradation.,  64  (13.0): [PMID:34170703] [10.1021/acs.jmedchem.1c00629]

Source