The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-fluoro-N-(2-(3'-methoxy-[1,1'-biphenyl]-4-yl)ethyl)quinazolin-4-amine ID: ALA5280170
Max Phase: Preclinical
Molecular Formula: C23H20FN3O
Molecular Weight: 373.43
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(-c2ccc(CCNc3ncnc4ccc(F)cc34)cc2)c1
Standard InChI: InChI=1S/C23H20FN3O/c1-28-20-4-2-3-18(13-20)17-7-5-16(6-8-17)11-12-25-23-21-14-19(24)9-10-22(21)26-15-27-23/h2-10,13-15H,11-12H2,1H3,(H,25,26,27)
Standard InChI Key: LCQLCOKAWRZYQK-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
-3.9275 -1.4409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2129 -1.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5011 -1.4405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5011 -2.2656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2111 -2.6774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9275 -2.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7833 -2.6798 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0716 -2.2631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0734 -1.4421 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7884 -1.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7884 -0.2044 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0737 0.2081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3591 -0.2044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3554 0.2081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3557 1.0333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0685 1.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7834 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7850 0.2102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0732 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4981 1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4983 2.2691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2111 2.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9260 2.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9276 1.4460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2157 1.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6422 -1.0282 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.6422 1.0334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6422 0.2082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
3 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 2 0
14 19 1 0
20 17 1 0
21 20 2 0
22 21 1 0
23 22 2 0
24 23 1 0
25 24 2 0
20 25 1 0
1 26 1 0
24 27 1 0
27 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 373.43Molecular Weight (Monoisotopic): 373.1590AlogP: 5.10#Rotatable Bonds: 6Polar Surface Area: 47.04Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.99CX LogP: 5.14CX LogD: 5.14Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.51Np Likeness Score: -1.16
References 1. Elsocht M, Giron P, De Grève J, Ballet S.. (2023) Second generation Spautin-1 analogues targeting EGFR-mutant non-small cell lung cancer cells., 79 [PMID:36410591 ] [10.1016/j.bmcl.2022.129066 ]