6-fluoro-N-(2-(3'-methoxy-[1,1'-biphenyl]-4-yl)ethyl)quinazolin-4-amine

ID: ALA5280170

Max Phase: Preclinical

Molecular Formula: C23H20FN3O

Molecular Weight: 373.43

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(-c2ccc(CCNc3ncnc4ccc(F)cc34)cc2)c1

Standard InChI:  InChI=1S/C23H20FN3O/c1-28-20-4-2-3-18(13-20)17-7-5-16(6-8-17)11-12-25-23-21-14-19(24)9-10-22(21)26-15-27-23/h2-10,13-15H,11-12H2,1H3,(H,25,26,27)

Standard InChI Key:  LCQLCOKAWRZYQK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   -3.9275   -1.4409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2129   -1.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5011   -1.4405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5011   -2.2656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2111   -2.6774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9275   -2.2693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7833   -2.6798    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0716   -2.2631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0734   -1.4421    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7884   -1.0296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7884   -0.2044    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0737    0.2081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3591   -0.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3554    0.2081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3557    1.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0685    1.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7834    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7850    0.2102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0732   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4981    1.4439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4983    2.2691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2111    2.6798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9260    2.2671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9276    1.4460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2157    1.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6422   -1.0282    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.6422    1.0334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6422    0.2082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
  3 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 14 19  1  0
 20 17  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 20 25  1  0
  1 26  1  0
 24 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5280170

    ---

Associated Targets(Human)

PC-9 (1037 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 373.43Molecular Weight (Monoisotopic): 373.1590AlogP: 5.10#Rotatable Bonds: 6
Polar Surface Area: 47.04Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 3.99CX LogP: 5.14CX LogD: 5.14
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.51Np Likeness Score: -1.16

References

1. Elsocht M, Giron P, De Grève J, Ballet S..  (2023)  Second generation Spautin-1 analogues targeting EGFR-mutant non-small cell lung cancer cells.,  79  [PMID:36410591] [10.1016/j.bmcl.2022.129066]

Source