The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 4-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-indol-3-yl]acetyl]carbamothioylamino]benzoate ID: ALA5280219
Max Phase: Preclinical
Molecular Formula: C28H24ClN3O5S
Molecular Weight: 550.04
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc(NC(=S)NC(=O)Cc2c(C)n(C(=O)c3ccc(Cl)cc3)c3ccc(OC)cc23)cc1
Standard InChI: InChI=1S/C28H24ClN3O5S/c1-16-22(15-25(33)31-28(38)30-20-10-6-18(7-11-20)27(35)37-3)23-14-21(36-2)12-13-24(23)32(16)26(34)17-4-8-19(29)9-5-17/h4-14H,15H2,1-3H3,(H2,30,31,33,38)
Standard InChI Key: WJJBVVABDFZQLH-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
-2.7396 1.1576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9146 1.1576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6644 0.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3180 -0.1171 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9855 0.3748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7839 0.1973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3392 0.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0963 1.5810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2971 1.7643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8717 0.1411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3180 -0.9378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6072 -1.3481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0287 -1.3481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8964 -0.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1881 -1.3477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1881 -2.1687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8946 -2.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6072 -2.1723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5225 -2.5790 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.5042 1.8683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6835 1.8683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2732 2.5790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2732 1.1576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5474 1.1576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9577 0.4469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9577 1.8683 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.7785 0.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1890 1.1575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0072 1.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4177 0.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0107 -0.2621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1905 -0.2668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6766 2.1613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.4694 1.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2384 0.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6487 1.1565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6487 -0.2649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4694 -0.2649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
1 5 2 0
5 4 1 0
5 6 1 0
7 6 2 0
8 7 1 0
9 8 2 0
1 9 1 0
3 10 1 0
4 11 1 0
11 12 1 0
11 13 2 0
14 12 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
12 18 1 0
16 19 1 0
2 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
28 27 2 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 2 0
27 32 1 0
8 33 1 0
33 34 1 0
30 35 1 0
35 36 2 0
35 37 1 0
37 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 550.04Molecular Weight (Monoisotopic): 549.1125AlogP: 5.14#Rotatable Bonds: 6Polar Surface Area: 98.66Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.23CX Basic pKa: ┄CX LogP: 5.51CX LogD: 5.51Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.25Np Likeness Score: -1.32
References 1. Ahmadi M, Bekeschus S, Weltmann KD, von Woedtke T, Wende K.. (2022) Non-steroidal anti-inflammatory drugs: recent advances in the use of synthetic COX-2 inhibitors., 13 (5.0): [PMID:35685617 ] [10.1039/d1md00280e ]