methyl 4-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-indol-3-yl]acetyl]carbamothioylamino]benzoate

ID: ALA5280219

Max Phase: Preclinical

Molecular Formula: C28H24ClN3O5S

Molecular Weight: 550.04

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1ccc(NC(=S)NC(=O)Cc2c(C)n(C(=O)c3ccc(Cl)cc3)c3ccc(OC)cc23)cc1

Standard InChI:  InChI=1S/C28H24ClN3O5S/c1-16-22(15-25(33)31-28(38)30-20-10-6-18(7-11-20)27(35)37-3)23-14-21(36-2)12-13-24(23)32(16)26(34)17-4-8-19(29)9-5-17/h4-14H,15H2,1-3H3,(H2,30,31,33,38)

Standard InChI Key:  WJJBVVABDFZQLH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   -2.7396    1.1576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9146    1.1576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6644    0.3535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3180   -0.1171    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9855    0.3748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7839    0.1973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3392    0.8017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0963    1.5810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2971    1.7643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8717    0.1411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3180   -0.9378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6072   -1.3481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0287   -1.3481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8964   -0.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1881   -1.3477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1881   -2.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8946   -2.5783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6072   -2.1723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5225   -2.5790    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.5042    1.8683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6835    1.8683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2732    2.5790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2732    1.1576    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5474    1.1576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9577    0.4469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9577    1.8683    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.7785    0.4469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1890    1.1575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0072    1.1567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4177    0.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0107   -0.2621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1905   -0.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6766    2.1613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4694    1.9490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2384    0.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6487    1.1565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6487   -0.2649    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4694   -0.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  1  5  2  0
  5  4  1  0
  5  6  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
  1  9  1  0
  3 10  1  0
  4 11  1  0
 11 12  1  0
 11 13  2  0
 14 12  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 12 18  1  0
 16 19  1  0
  2 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
  8 33  1  0
 33 34  1  0
 30 35  1  0
 35 36  2  0
 35 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5280219

    ---

Associated Targets(non-human)

PTGS2 Cyclooxygenase-2 (1953 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 550.04Molecular Weight (Monoisotopic): 549.1125AlogP: 5.14#Rotatable Bonds: 6
Polar Surface Area: 98.66Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.23CX Basic pKa: CX LogP: 5.51CX LogD: 5.51
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.25Np Likeness Score: -1.32

References

1. Ahmadi M, Bekeschus S, Weltmann KD, von Woedtke T, Wende K..  (2022)  Non-steroidal anti-inflammatory drugs: recent advances in the use of synthetic COX-2 inhibitors.,  13  (5.0): [PMID:35685617] [10.1039/d1md00280e]

Source