N,N'-(((2S,2aS,4aS,6S,6aS)-2,6-dimethylhexahydro-1,3,5-trioxa-2a1-azacyclopenta[cd]pentalene-2,6-diyl)bis(methylene))dibenzamide

ID: ALA5280220

Max Phase: Preclinical

Molecular Formula: C24H27N3O5

Molecular Weight: 437.50

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@]1(CNC(=O)c2ccccc2)O[C@H]2CO[C@@H]3N2[C@H]1O[C@@]3(C)CNC(=O)c1ccccc1

Standard InChI:  InChI=1S/C24H27N3O5/c1-23(14-25-19(28)16-9-5-3-6-10-16)21-27-18(13-30-21)31-24(2,22(27)32-23)15-26-20(29)17-11-7-4-8-12-17/h3-12,18,21-22H,13-15H2,1-2H3,(H,25,28)(H,26,29)/t18-,21-,22-,23-,24-/m0/s1

Standard InChI Key:  RCBQLXKYTJBUOW-NHKCCNDQSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   -0.6031    0.2384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1823    0.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1543    1.3605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9397    1.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4727    0.9678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9958    0.2665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2763   -0.5189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1179   -0.6872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3984   -1.4727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2119   -1.6129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4925   -2.3984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3340   -2.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8670   -1.9215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5865   -1.1361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7730   -0.9678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8374   -2.1179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5750   -0.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6311    2.5387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1823    2.5667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6592    1.5849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1080    0.8836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9496    0.8556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3984    1.5849    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2400    1.5569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6327    0.7994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4743    0.7714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8670    0.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4182   -0.6872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5766   -0.6591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1839    0.0982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6888    2.2582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5569    0.1543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2483    2.1740    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6691    2.0338    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1823   -0.3225    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  3  1  0
  5  4  1  0
  2  6  1  0
  6  5  1  0
  6  7  1  1
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  9 16  2  0
  6 17  1  0
  4 18  1  0
 19 18  1  0
 20  3  1  0
 20 19  1  0
 20 21  1  0
 21  1  1  0
 21 22  1  1
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 24 31  2  0
 21 32  1  0
 20 33  1  1
  4 34  1  1
  2 35  1  1
M  END

Alternative Forms

  1. Parent:

    ALA5280220

    ---

Associated Targets(Human)

HCRTR2 Tclin Orexin receptor 2 (5902 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.50Molecular Weight (Monoisotopic): 437.1951AlogP: 1.73#Rotatable Bonds: 6
Polar Surface Area: 89.13Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.95CX LogD: 2.95
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.72Np Likeness Score: 0.06

References

1. Amezawa M, Yamamoto N, Nagumo Y, Kutsumura N, Ishikawa Y, Yanagisawa M, Nagase H, Saitoh T..  (2023)  Design and synthesis of novel orexin 2 receptor agonists with a 1,3,5‑trioxazatriquinane skeleton.,  82  [PMID:36690040] [10.1016/j.bmcl.2023.129151]

Source