Ferroptocide

ID: ALA5280413

Max Phase: Preclinical

Molecular Formula: C30H36ClN3O7

Molecular Weight: 586.09

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1CC[C@@]23C[C@H](O)C(=O)[C@@]2(O)[C@]1(C)[C@H](OC(=O)CCl)C[C@@H](C1=CCn2c(=O)n(-c4ccccc4)c(=O)n2C1)[C@@H]3C

Standard InChI:  InChI=1S/C30H36ClN3O7/c1-17-9-11-29-14-22(35)25(37)30(29,40)28(17,3)23(41-24(36)15-31)13-21(18(29)2)19-10-12-32-26(38)34(27(39)33(32)16-19)20-7-5-4-6-8-20/h4-8,10,17-18,21-23,35,40H,9,11-16H2,1-3H3/t17?,18-,21+,22-,23+,28-,29-,30+/m0/s1

Standard InChI Key:  LLYJISDUHFXOHK-RYOXJCFPSA-N

Molfile:  

 
     RDKit          2D

 41 46  0  0  0  0  0  0  0  0999 V2000
    1.3844    4.6392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6698    4.2269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0963    4.2272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0963    3.4021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3862    2.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6698    3.3984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7818    1.6100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1140    0.8501    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9155    0.9310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1008    1.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3862    2.1651    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7833    0.1156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2540   -0.5380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3862    0.2773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0555   -0.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7984    2.1552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0038    1.8185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0385   -1.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4643   -1.8681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2847   -2.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4472   -3.0037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1701   -2.6534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3496   -1.8681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8513   -1.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3578   -3.9416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7306   -3.2517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5489   -3.8506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0206   -4.4201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7605   -4.6392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4449   -2.1982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6874   -3.3515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0905   -3.1430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7880   -3.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3850   -3.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0115   -2.3067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2423   -1.6597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4508   -0.8817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2288   -0.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8813   -0.3121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7984   -1.2427    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.1276   -1.6597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  2  6  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
 11  7  1  0
 11  5  1  0
  8 12  1  0
 13 12  1  0
  9 14  1  0
 15 14  1  0
 15 13  2  0
 10 16  2  0
  7 17  2  0
 19 18  1  0
 20 19  1  0
 21 20  1  0
 22 21  1  0
 23 22  1  0
 24 23  1  0
 24 18  1  0
 24 13  1  1
 26 25  1  0
 22 26  1  0
 25 27  1  0
 21 27  1  0
 27 28  2  0
 25 29  1  6
 21 30  1  6
 20 31  1  0
 31 32  1  0
 32 33  1  0
 22 33  1  1
 31 34  1  0
 20 35  1  6
 19 36  1  6
 36 37  1  0
 37 38  1  0
 37 39  2  0
 38 40  1  0
 23 41  1  6
M  END

Alternative Forms

  1. Parent:

    ALA5280413

    ---

Associated Targets(Human)

ES-2 (58 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 586.09Molecular Weight (Monoisotopic): 585.2242AlogP: 2.03#Rotatable Bonds: 4
Polar Surface Area: 132.76Molecular Species: NEUTRALHBA: 10HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.20CX Basic pKa: CX LogP: 3.06CX LogD: 3.06
Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.32Np Likeness Score: 1.48

References

1. Yin L, Liu P, Jin Y, Ning Z, Yang Y, Gao H..  (2022)  Ferroptosis-related small-molecule compounds in cancer therapy: Strategies and applications.,  244  [PMID:36332549] [10.1016/j.ejmech.2022.114861]

Source